•  
SSL
0item(s)

You have no items in your shopping cart.

Product was successfully added to your shopping cart.

Cytoskeletal Signaling

Set Ascending Direction

   

Items 11 to 20 of 67 total

  1. 1
  2. 2
  3. 3
  4. 4
  5. 5
  1. PF-04929113; SNX-5422

    CAS No.: 908115-27-5
    Catalog No.: 151755
    Purity: 95%
    MF: C25H30F3N5O4
    MW: 521.54
    Storage: 2-8 degree Celsius
    SMILES: CC1(C)CC2=C(C(=NN2C2=CC(N[C@H]3CC[C@@H](CC3)OC(=O)CN)=C(C=C2)C(N)=O)C(F)(F)F)C(=O)C1
  2. Ixabepilone; BMS-247550

    CAS No.: 219989-84-1
    Catalog No.: 152126
    Purity: 95%
    MF: C27H42N2O5S
    MW: 506.709
    Storage: 2-8 degree Celsius
    SMILES: C[C@H]1CCC[C@@]2(C)O[C@H]2C[C@H](NC(=O)C[C@H](O)C(C)(C)C(=O)[C@H](C)[C@H]1O)C(\C)=C\C1=CSC(C)=N1
  3. INH6

    CAS No.: 1001753-24-7
    Catalog No.: 152004
    Purity: 95%
    MF: C19H18N2OS
    MW: 322.433
    Storage: 2-8 degree Celsius
    SMILES: CC1=CC(C)=C(C2=CSC(NC(=O)C3=CC=CC=C3)=N2)C(C)=C1
  4. Fosbretabulin (Combretastatin A4 Phosphate (CA4P)) Disodium

    CAS No.: 168555-66-6
    Catalog No.: 151962
    Purity: 95%
    MF: C18H19Na2O8P
    MW: 440.296
    Storage: 2-8 degree Celsius
    SMILES: [Na+].[Na+].COC1=CC=C(\C=C/C2=CC(OC)=C(OC)C(OC)=C2)C=C1OP([O-])([O-])=O
  5. AGK2

    CAS No.: 304896-28-4
    Catalog No.: 152031
    Purity: 95%
    MF: C23H13Cl2N3O2
    MW: 434.282
    Storage: 2-8 degree Celsius
    SMILES: ClC1=CC(C2=CC=C(O2)C=C(C#N)C(=O)NC2=C3C=CC=NC3=CC=C2)=C(Cl)C=C1
  6. Griseofulvin

    CAS No.: 126-07-8
    Catalog No.: 151865
    Purity: 95%
    MF: C17H19ClO6
    MW: 354.786
    Storage: 2-8 degree Celsius
    SMILES: COC1CC(=O)C[C@@H](C)[C@]11OC2=C(Cl)C(OC)=CC(OC)=C2C1=O
  7. Givinostat; ITF2357

    CAS No.: 732302-99-7
    Catalog No.: 151598
    Purity: 95%
    MF: C24H30ClN3O5
    MW: 475.973
    Storage: 2-8 degree Celsius
    SMILES: O.Cl.CCN(CC)CC1=CC=C2C=C(COC(=O)NC3=CC=C(C=C3)C(=O)NO)C=CC2=C1
  8. PU-H71

    CAS No.: 873436-91-0
    Catalog No.: 186131
    Purity: 95%
    MF: C18H21IN6O2S
    MW: 512.377
    Storage: 2-8 degree Celsius
    SMILES: IC=1C(=CC2=C(OCO2)C1)SC=1N(C2=NC=NC(=C2N1)N)CCCNC(C)C
  9. Eribulin Mesylate

    CAS No.: 441045-17-6
    Catalog No.: WLZ1416
    Purity: 95%
    MF: C41H63NO14S
    MW: 826.015
    Storage: 2-8 degree Celsius
    SMILES: S(O)(=O)(=O)C.C=C1[C@@]([H])2CC[C@]([H])3C[C@@H](C)C(=C)[C@@]([H])(C[C@@]([H])4O[C@H](C[C@H](O)CN)[C@H](OC)[C@@]4([H])CC(=O)C[C@]([H])4CC[C@@]([H])5O[C@@]([H])6[C@]([H])7O[C@]([H])8[C@]6([H])O[C@](C8)(O[C@H]7[C@@]5([H])O4)CC[C@]([H])(O2)C1)O3
  10. YUM70

    CAS No.: 423145-35-1
    Catalog No.: WLZ0219
    Purity: 95%
    MF: C21H19ClN2O4
    MW: 398.846
    Storage: 2-8 degree Celsius
    SMILES: O1COC2=C1C=CC(=C2)C(NC(CCC)=O)C2=CC(=C1C=CC=NC1=C2O)Cl
Loading ...Load More ...
Set Ascending Direction

   

Items 11 to 20 of 67 total

  1. 1
  2. 2
  3. 3
  4. 4
  5. 5