•  
SSL
0item(s)

You have no items in your shopping cart.

Product was successfully added to your shopping cart.

Cytoskeletal Signaling

Set Descending Direction

   

Items 1 to 10 of 67 total

  1. 1
  2. 2
  3. 3
  4. 4
  5. 5
  1. Splitomicin

    CAS No.: 5690-03-9
    Catalog No.: 152036
    Purity: 95%
    MF: C13H10O2
    MW: 198.221
    Storage: 2-8 degree Celsius
    SMILES: O=C1CCC2=C(O1)C=CC1=CC=CC=C21
  2. Dyngo-4a

    CAS No.: 1256493-34-1
    Catalog No.: 141870
    Purity: 95%
    MF: C18H14N2O5
    MW: 338.319
    Storage: 2-8 degree Celsius
    SMILES: OC1=CC(O)=C(C=NNC(=O)C2=CC3=CC=CC=C3C=C2O)C=C1O
  3. DTHIB

    CAS No.: 897326-30-6
    Catalog No.: 193658
    Purity: 95%
    MF: C13H9ClFN3O3
    MW: 309.684
    Storage: 2-8 degree Celsius
    SMILES: ClC1=C(C=C(C=C1)NC(=O)NC1=CC=C(C=C1)F)[N+](=O)[O-]
  4. Lifitegrast

    CAS No.: 1025967-78-5
    Catalog No.: 183286
    Purity: 95%
    MF: C29H24Cl2N2O7S
    MW: 615.491
    Storage: 2-8 degree Celsius
    SMILES: CS(=O)(=O)C1=CC=CC(C[C@H](NC(=O)C2=C(Cl)C3=C(CN(CC3)C(=O)C3=CC=C4C=COC4=C3)C=C2Cl)C(O)=O)=C1
  5. GLPG0187

    CAS No.: 1320346-97-1
    Catalog No.: 181942
    Purity: 95%
    MF: C29H37N7O5S
    MW: 595.726
    Storage: 2-8 degree Celsius
    SMILES: COC1=CC=C(C=C1)S(=O)(=O)N[C@@H](CNC1=C(C)C(=NC(C)=N1)N1CCC(CC1)C1=CC=C2CCCNC2=N1)C(O)=O
  6. Dynasore

    CAS No.: 304448-55-3
    Catalog No.: 152154
    Purity: 95%
    MF: C18H14N2O4
    MW: 322.32
    Storage: 2-8 degree Celsius
    SMILES: OC1=CC2=CC=CC=C2C=C1C(=O)NN=CC1=CC(O)=C(O)C=C1
  7. Cucurbitacin B

    CAS No.: 6199-67-3
    Catalog No.: 152174
    Purity: 95%
    MF: C32H46O8
    MW: 558.712
    Storage: 2-8 degree Celsius
    SMILES: [H][C@@]12C[C@H](O)C(=O)C(C)(C)C1=CC[C@@]1([H])[C@]3(C)C[C@@H](O)[C@H]([C@@](C)(O)C(=O)\C=C\C(C)(C)OC(C)=O)[C@@]3(C)CC(=O)[C@@]21C
  8. VER155008

    CAS No.: 1134156-31-2
    Catalog No.: 152076
    Purity: 95%
    MF: C25H23Cl2N7O4
    MW: 556.41
    Storage: 2-8 degree Celsius
    SMILES: NC1=C2N=C(NCC3=CC(Cl)=C(Cl)C=C3)N([C@@H]3O[C@H](COCC4=CC=C(C=C4)C#N)[C@@H](O)[C@H]3O)C2=NC=N1
  9. Tirofiban

    CAS No.: 144494-65-5
    Catalog No.: 151819
    Purity: 95%
    MF: C22H36N2O5S
    MW: 440.606
    Storage: 2-8 degree Celsius
    SMILES: CCCCS(=O)(=O)N[C@@H](CC1=CC=C(OCCCCC2CCNCC2)C=C1)C(O)=O
  10. FRAX597

    CAS No.: 1286739-19-2
    Catalog No.: 141894
    Purity: 95%
    MF: C29H28ClN7OS
    MW: 558.111
    Storage: 2-8 degree Celsius
    SMILES: CCN1C(=O)C(=CC2=C1N=C(NC1=CC=C(C=C1)N1CCN(C)CC1)N=C2)C1=C(Cl)C=C(C=C1)C1=CN=CS1
Loading ...Load More ...
Set Descending Direction

   

Items 1 to 10 of 67 total

  1. 1
  2. 2
  3. 3
  4. 4
  5. 5