•  
SSL
0item(s)

You have no items in your shopping cart.

Product was successfully added to your shopping cart.

Cyclohexanes

Set Ascending Direction

   

Items 1 to 10 of 1130 total

  1. 1
  2. 2
  3. 3
  4. 4
  5. 5
  1. 2-bromo-N-(cyclohexylmethyl)acetamide

    CAS No.: 895244-78-7
    Catalog No.: 100589
    Purity: 95%
    MF: C9H16BrNO
    MW: 234.137
    Storage: 2-8 degree Celsius
    SMILES: BrCC(=O)NCC1CCCCC1
  2. N-(2,2-dimethoxyethyl)cyclohexanamine

    CAS No.: 99863-45-3
    Catalog No.: 100619
    Purity: 95%
    MF: C10H21NO2
    MW: 187.283
    Storage: 2-8 degree Celsius
    SMILES: COC(CNC1CCCCC1)OC
  3. N-cyclohexyl-N-(2,2-dimethoxyethyl)acrylamide

    CAS No.: 1035229-41-4
    Catalog No.: 100621
    Purity: 95%
    MF: C13H23NO3
    MW: 241.331
    Storage: 2-8 degree Celsius
    SMILES: COC(CN(C1CCCCC1)C(=O)C=C)OC
  4. N-cyclohexyl-N-(2-oxoethyl)acrylamide

    CAS No.: 1035229-42-5
    Catalog No.: 100622
    Purity: 95%
    MF: C11H17NO2
    MW: 195.262
    Storage: 2-8 degree Celsius
    SMILES: C=CC(=O)N(CC=O)C1CCCCC1
  5. (4,4-difluoroadamantan-1-yl)methanol

    CAS No.: 1283719-51-6
    Catalog No.: 100792
    Purity: 95%
    MF: C11H16F2O
    MW: 202.244
    Storage: 2-8 degree Celsius
    SMILES: OCC12CC3CC(C1)C(F)(F)C(C3)C2
  6. 3-fluoroadamantane-1-methanol

    CAS No.: 106094-47-7
    Catalog No.: 100793
    Purity: 95%
    MF: C11H17FO
    MW: 184.254
    Storage: 2-8 degree Celsius
  7. 4-(trifluoromethyl)cyclohexanamine

    CAS No.: 58665-70-6
    Catalog No.: 100801
    Purity: 95%
    MF: C7H12F3N
    MW: 167.174
    Storage: 2-8 degree Celsius
    SMILES: NC1CCC(CC1)C(F)(F)F
  8. methyl 4-aminocyclohexanecarboxylate

    CAS No.: 175867-59-1
    Catalog No.: 101102
    Purity: 95%
    MF: C8H15NO2
    MW: 157.213
    Storage: 2-8 degree Celsius
  9. trans methyl 4-aminocyclohexanecarboxylate

    CAS No.: 62456-15-9
    Catalog No.: 101103
    Purity: 95%
    MF: C8H15NO2
    MW: 157.213
    Storage: 2-8 degree Celsius
    SMILES: COC(=O)[C@H]1CC[C@H](N)CC1
  10. Ambroxol EP Impurity C

    CAS No.: 50910-53-7
    Catalog No.: 101609
    Purity: 95%
    MF: C13H16Br2N2O
    MW: 376.092
    Storage: 2-8 degree Celsius
Loading ...Load More ...
Set Ascending Direction

   

Items 1 to 10 of 1130 total

  1. 1
  2. 2
  3. 3
  4. 4
  5. 5