•  
SSL
0item(s)

You have no items in your shopping cart.

Product was successfully added to your shopping cart.

Cyclobutanes

Set Descending Direction

   

Items 1 to 10 of 506 total

  1. 1
  2. 2
  3. 3
  4. 4
  5. 5
  1. (1R,3R)-3-(4-nitro-1H-imidazol-1-yl)cyclobutyl 4-methylbenzenesulfonate

    CAS No.: 395074-92-7
    Catalog No.: 100095
    Purity: 95%
    MF: C14H15N3O5S
    MW: 337.357
    Storage: 2-8 degree Celsius
  2. cis-tert-butyl 3-(4-nitro-1H-imidazol-1-yl)cyclobutylcarbamate

    CAS No.: 1364663-31-9
    Catalog No.: 100097
    Purity: 95%
    MF: C12H18N4O4
    MW: 282.3
    Storage: 2-8 degree Celsius
  3. methyl 1-(4-bromophenyl)-3-oxocyclobutanecarboxylate

    CAS No.: 1364663-42-2
    Catalog No.: 100138
    Purity: 95%
    MF: C12H11BrO3
    MW: 283.121
    Storage: 2-8 degree Celsius
    SMILES: COC(=O)C1(CC(=O)C1)C1=CC=C(Br)C=C1
  4. benzyl 2-cyclobutoxyacetate

    CAS No.: 1364663-26-2
    Catalog No.: 100259
    Purity: 95%
    MF: C13H16O3
    MW: 220.268
    Storage: 2-8 degree Celsius
  5. 3-(benzyloxy)cyclobutanamine

    CAS No.: 92146-77-5
    Catalog No.: 100261
    Purity: 95%
    MF: C11H15NO
    MW: 177.247
    Storage: 2-8 degree Celsius
    SMILES: NC1CC(C1)OCC1=CC=CC=C1
  6. 3-aminocyclobutanol

    CAS No.: 1036260-25-9
    Catalog No.: 100262
    Purity: 95%
    MF: C4H9NO
    MW: 87.122
    Storage: 2-8 degree Celsius
    SMILES: NC1CC(O)C1
  7. 3-oxocyclobutyl acetate

    CAS No.: 63930-59-6
    Catalog No.: 100263
    Purity: 95%
    MF: C6H8O3
    MW: 128.127
    Storage: 2-8 degree Celsius
    SMILES: CC(=O)OC1CC(=O)C1
  8. 1-(4-(2-amino-4-methylthiazol-5-yl)pyridin-2-yl)cyclobutanecarbonitrile

    CAS No.: 1163707-57-0
    Catalog No.: 100437
    Purity: 95%
    MF: C14H14N4S
    MW: 270.361
    Storage: 2-8 degree Celsius
    SMILES: CC1=C(SC(N)=N1)C1=CC(=NC=C1)C1(CCC1)C#N
  9. methyl 3-(benzyloxy)cyclobutanecarboxylate

    CAS No.: 4934-98-9
    Catalog No.: 100861
    Purity: 95%
    MF: C13H16O3
    MW: 220.268
    Storage: 2-8 degree Celsius
  10. 3-benzyloxy-cyclobutanecarboxylic acid

    CAS No.: 4958-02-5
    Catalog No.: 100862
    Purity: 95%
    MF: C12H14O3
    MW: 206.241
    Storage: 2-8 degree Celsius
    SMILES: OC(=O)C1CC(C1)OCC1=CC=CC=C1
Loading ...Load More ...
Set Descending Direction

   

Items 1 to 10 of 506 total

  1. 1
  2. 2
  3. 3
  4. 4
  5. 5