•  
SSL
0item(s)

You have no items in your shopping cart.

Product was successfully added to your shopping cart.

COX

Set Descending Direction

   

Items 1 to 10 of 48 total

  1. 1
  2. 2
  3. 3
  4. 4
  5. 5
  1. Zaltoprofen

    CAS No.: 74711-43-6
    Catalog No.: 151792
    Purity: 95%
    MF: C17H14O3S
    MW: 298.363
    Storage: 2-8 degree Celsius
    SMILES: CC(C(O)=O)C1=CC2=C(SC3=CC=CC=C3C(=O)C2)C=C1
  2. Etodolac

    CAS No.: 41340-25-4
    Catalog No.: 151411
    Purity: 95%
    MF: C17H21NO3
    MW: 287.359
    Storage: 2-8 degree Celsius
    SMILES: CCC1=C2NC3=C(CCOC3(CC)CC(O)=O)C2=CC=C1
  3. Flunixin Meglumin

    CAS No.: 42461-84-7
    Catalog No.: 151589
    Purity: 95%
    MF: C21H28F3N3O7
    MW: 491.463
    Storage: 2-8 degree Celsius
    SMILES: CNC[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO.CC1=C(C=CC=C1NC1=C(C=CC=N1)C(O)=O)C(F)(F)F
  4. Ibuprofen

    CAS No.: 15687-27-1
    Catalog No.: 151472
    Purity: 95%
    MF: C13H18O2
    MW: 206.285
    Storage: 2-8 degree Celsius
    SMILES: CC(C)CC1=CC=C(C=C1)C(C)C(O)=O
  5. Ketoprofen

    CAS No.: 22071-15-4
    Catalog No.: 151476
    Purity: 95%
    MF: C16H14O3
    MW: 254.285
    Storage: 2-8 degree Celsius
    SMILES: CC(C(O)=O)C1=CC(=CC=C1)C(=O)C1=CC=CC=C1
  6. Ketorolac

    CAS No.: 74103-07-4
    Catalog No.: 151477
    Purity: 95%
    MF: C19H24N2O6
    MW: 376.409
    Storage: 2-8 degree Celsius
    SMILES: NC(CO)(CO)CO.OC(=O)C1CCN2C1=CC=C2C(=O)C1=CC=CC=C1
  7. Pranoprofen

    CAS No.: 52549-17-4
    Catalog No.: 151546
    Purity: 95%
    MF: C15H13NO3
    MW: 255.273
    Storage: 2-8 degree Celsius
    SMILES: CC(C(O)=O)C1=CC=C2OC3=C(CC2=C1)C=CC=N3
  8. Suprofen

    CAS No.: 40828-46-4
    Catalog No.: 151499
    Purity: 95%
    MF: C14H12O3S
    MW: 260.314
    Storage: 2-8 degree Celsius
    SMILES: CC(C(O)=O)C1=CC=C(C=C1)C(=O)C1=CC=CS1
  9. Acemetacin

    CAS No.: 53164-05-9
    Catalog No.: 151744
    Purity: 95%
    MF: C21H18ClNO6
    MW: 415.829
    Storage: 2-8 degree Celsius
    SMILES: COC1=CC=C2N(C(=O)C3=CC=C(Cl)C=C3)C(C)=C(CC(=O)OCC(O)=O)C2=C1
  10. Bufexamac

    CAS No.: 2438-72-4
    Catalog No.: 151795
    Purity: 95%
    MF: C12H17NO3
    MW: 223.272
    Storage: 2-8 degree Celsius
    SMILES: CCCCOC1=CC=C(CC(=O)NO)C=C1
Loading ...Load More ...
Set Descending Direction

   

Items 1 to 10 of 48 total

  1. 1
  2. 2
  3. 3
  4. 4
  5. 5