•  
SSL
0item(s)

You have no items in your shopping cart.

Product was successfully added to your shopping cart.

Chromenes

Set Descending Direction

   

Items 1 to 10 of 375 total

  1. 1
  2. 2
  3. 3
  4. 4
  5. 5
  1. methyl 4-methyl-2-oxo-2H-chromen-7-ylcarbamate

    CAS No.: 114415-25-7
    Catalog No.: 100594
    Purity: 95%
    MF: C12H11NO4
    MW: 233.223
    Storage: 2-8 degree Celsius
    SMILES: COC(=O)NC1=CC2=C(C=C1)C(C)=CC(=O)O2
  2. 7-amino-4-methyl-2H-chromen-2-one

    CAS No.: 26093-31-2
    Catalog No.: 100595
    Purity: 95%
    MF: C10H9NO2
    MW: 175.187
    Storage: 2-8 degree Celsius
    SMILES: CC1=CC(=O)OC2=C1C=CC(N)=C2
  3. methyl 4-oxo-2-phenyl-4H-chromene-3-carboxylate

    CAS No.: 51081-70-0
    Catalog No.: 101199
    Purity: 95%
    MF: C17H12O4
    MW: 280.279
    Storage: 2-8 degree Celsius
    SMILES: COC(=O)C1=C(OC2=C(C=CC=C2)C1=O)C1=CC=CC=C1
  4. 4-methyl-7-(((2S,3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)tetrahydro-2H-pyran-2-yl)oxy)-2H-chromen-2-one

    CAS No.: 6160-78-7
    Catalog No.: 101823
    Purity: 95%
    MF: C16H18O8
    MW: 338.312
    Storage: 2-8 degree Celsius
    SMILES: CC1=CC(=O)OC2=C1C=CC(O[C@@H]1O[C@H](CO)[C@H](O)[C@H](O)[C@H]1O)=C2
  5. 7-hydroxy-4-methyl-2H-chromen-2-one

    CAS No.: 90-33-5
    Catalog No.: 102434
    Purity: 95%
    MF: C10H8O3
    MW: 176.171
    Storage: 2-8 degree Celsius
  6. 6-bromo-2,3-dihydro-4H-chromen-4-one

    CAS No.: 49660-57-3
    Catalog No.: 102552
    Purity: 95%
    MF: C9H7BrO2
    MW: 227.057
    Storage: 2-8 degree Celsius
    SMILES: BrC1=CC2=C(OCCC2=O)C=C1
  7. 1,3-dioxo-1,3-dihydrobenzo[de]isochromene-6,7-dicarboxylic acid

    CAS No.: 52671-72-4
    Catalog No.: 103646
    Purity: 95%
    MF: C14H6O7
    MW: 286.195
    Storage: 2-8 degree Celsius
  8. 7-diethylamino-4-hydroxy-chromen-2-one

    CAS No.: 64369-55-7
    Catalog No.: 104242
    Purity: 95%
    MF: C13H15NO3
    MW: 233.267
    Storage: 2-8 degree Celsius
  9. 6-bromo-2-oxo-2H-chromene-3-carboxylic acid

    CAS No.: 2199-87-3
    Catalog No.: 104269
    Purity: 95%
    MF: C10H5BrO4
    MW: 269.05
    Storage: 2-8 degree Celsius
    SMILES: OC(=O)C1=CC2=C(OC1=O)C=CC(Br)=C2
  10. 2-(1-chloroethyl)-3-phenyl-4H-chromen-4-one

    CAS No.: 1260178-76-4
    Catalog No.: 104508
    Purity: 95%
    MF: C17H13ClO2
    MW: 284.742
    Storage: 2-8 degree Celsius
    SMILES: CC(Cl)C1=C(C(=O)C2=C(O1)C=CC=C2)C1=CC=CC=C1
Loading ...Load More ...
Set Descending Direction

   

Items 1 to 10 of 375 total

  1. 1
  2. 2
  3. 3
  4. 4
  5. 5