•  
SSL
0item(s)

You have no items in your shopping cart.

Product was successfully added to your shopping cart.

Chiral amine

Set Ascending Direction

   

Items 41 to 50 of 981 total

  1. 3
  2. 4
  3. 5
  4. 6
  5. 7
  1. (S)-7-(trifluoromethyl)chroman-4-amine

    CAS No.: 1140496-05-4
    Catalog No.: 134137
    Purity: 95%
    MF: C10H10F3NO
    MW: 217.19
    Storage: 2-8 degree Celsius
  2. (R)-6-fluoro-indan-1-ylamine-hydrochloride

    CAS No.: 790208-54-7
    Catalog No.: 134144
    Purity: 95%
    MF: C9H11ClFN
    MW: 187.645
    Storage: 2-8 degree Celsius
  3. (R)-2-amino-2-(4-fluorophenyl)ethanol

    CAS No.: 174770-74-2
    Catalog No.: 134157
    Purity: 95%
    MF: C8H10FNO
    MW: 155.172
    Storage: 2-8 degree Celsius
  4. (1R)-1-(3,4-dichlorophenyl)ethan-1-amine

    CAS No.: 150520-10-8
    Catalog No.: 134172
    Purity: 95%
    MF: C8H9Cl2N
    MW: 190.073
    Storage: 2-8 degree Celsius
  5. (S)-2,2,2-trifluoro-1-(4-fluorophenyl)ethanamine hydrochloride

    CAS No.: 929642-58-0
    Catalog No.: 134183
    Purity: 95%
    MF: C8H8ClF4N
    MW: 229.604
    Storage: 2-8 degree Celsius
  6. (R)-1-(3-fluorophenyl)ethylamine hydrochloride

    CAS No.: 321429-49-6
    Catalog No.: 134189
    Purity: 95%
    MF: C8H11ClFN
    MW: 175.634
    Storage: 2-8 degree Celsius
  7. (S)-1-(2-methoxyphenyl)ethanamine hydrochloride

    CAS No.: 68285-24-5
    Catalog No.: 134190
    Purity: 95%
    MF: C9H14ClNO
    MW: 187.67
    Storage: 2-8 degree Celsius
  8. (R)-1-(2-fluorophenyl)ethylamine hydrochloride

    CAS No.: 1168139-43-2
    Catalog No.: 134191
    Purity: 95%
    MF: C8H11ClFN
    MW: 175.634
    Storage: 2-8 degree Celsius
    SMILES: Cl.C[C@@H](N)C1=C(F)C=CC=C1
  9. (S)-4-fluoro-2,3-dihydro-1H-inden-1-amine

    CAS No.: 946053-90-3
    Catalog No.: 134195
    Purity: 95%
    MF: C9H10FN
    MW: 151.184
    Storage: 2-8 degree Celsius
  10. (R)-4-(1-aminoethyl)-N,N-dimethylaniline dihydrochloride

    CAS No.: 122779-42-4
    Catalog No.: 134203
    Purity: 95%
    MF: C10H18Cl2N2
    MW: 237.174
    Storage: 2-8 degree Celsius
Loading ...Load More ...
Set Ascending Direction

   

Items 41 to 50 of 981 total

  1. 3
  2. 4
  3. 5
  4. 6
  5. 7