•  
SSL
0item(s)

You have no items in your shopping cart.

Product was successfully added to your shopping cart.

Chiral amine

Set Ascending Direction

   

Items 31 to 40 of 981 total

  1. 2
  2. 3
  3. 4
  4. 5
  5. 6
  1. tert-butyl (S)-1-(methoxycarbonyl)-2-hydroxyethylcarbamate

    CAS No.: 2766-43-0
    Catalog No.: 131082
    Purity: 95%
    MF: C9H17NO5
    MW: 219.237
    Storage: 2-8 degree Celsius
  2. tert-butyl (R)-1-(methoxycarbonyl)-2-iodoethylcarbamate

    CAS No.: 93267-04-0
    Catalog No.: 131083
    Purity: 95%
    MF: C9H16INO4
    MW: 329.134
    Storage: 2-8 degree Celsius
  3. (S)-7-fluorochroman-4-amine

    CAS No.: 1018978-91-0
    Catalog No.: 134062
    Purity: 95%
    MF: C9H10FNO
    MW: 167.183
    Storage: 2-8 degree Celsius
  4. (R)-1-(4-chlorophenyl)ethylamine

    CAS No.: 27298-99-3
    Catalog No.: 134064
    Purity: 95%
    MF: C8H10ClN
    MW: 155.628
    Storage: 2-8 degree Celsius
    SMILES: C[C@@H](N)C1=CC=C(Cl)C=C1
  5. (3R)-2,3-dihydrobenzo[b]furan-3-ylamine

    CAS No.: 1228553-27-2
    Catalog No.: 134079
    Purity: 95%
    MF: C8H9NO
    MW: 135.166
    Storage: 2-8 degree Celsius
    SMILES: N[C@H]1COC2=C1C=CC=C2
  6. (S)-(-)-1-(4-cyanophenyl)ethylamine

    CAS No.: 36244-70-9
    Catalog No.: 134085
    Purity: 95%
    MF: C9H10N2
    MW: 146.193
    Storage: 2-8 degree Celsius
  7. (2R)-2-amino-2-(4-bromophenyl)ethan-1-ol

    CAS No.: 354153-64-3
    Catalog No.: 134090
    Purity: 95%
    MF: C8H10BrNO
    MW: 216.078
    Storage: 2-8 degree Celsius
  8. (R)-1-(2-Naphthyl)ethylamine

    CAS No.: 3906-16-9
    Catalog No.: 134106
    Purity: 95%
    MF: C12H13N
    MW: 171.243
    Storage: 2-8 degree Celsius
  9. 7-bromo-1,2,3,4-tetrahydronaphthalen-1-amine

    CAS No.: 865472-04-4
    Catalog No.: 134115
    Purity: 95%
    MF: C10H12BrN
    MW: 226.117
    Storage: 2-8 degree Celsius
  10. (S)-4-bromo-2,3-dihydro-1H-inden-1-amine hydrochloride

    CAS No.: 1228570-71-5
    Catalog No.: 134119
    Purity: 95%
    MF: C9H11BrClN
    MW: 248.551
    Storage: 2-8 degree Celsius
Loading ...Load More ...
Set Ascending Direction

   

Items 31 to 40 of 981 total

  1. 2
  2. 3
  3. 4
  4. 5
  5. 6