•  
SSL
0item(s)

You have no items in your shopping cart.

Product was successfully added to your shopping cart.

Chiral amine

Set Ascending Direction

   

Items 1 to 10 of 981 total

  1. 1
  2. 2
  3. 3
  4. 4
  5. 5
  1. (S)-1-(5-fluoropyrimidin-2-yl)ethan-1-amine hydrochloride

    CAS No.: 935667-21-3
    Catalog No.: 100358
    Purity: 95%
    MF: C6H9ClFN3
    MW: 177.61
    Storage: 2-8 degree Celsius
    SMILES: Cl[H].C[C@H](N)C1=NC=C(F)C=N1
  2. (R)-2,3-dihydro-1H-inden-1-amine

    CAS No.: 10277-74-4
    Catalog No.: 101340
    Purity: 95%
    MF: C9H11N
    MW: 133.194
    Storage: 2-8 degree Celsius
  3. (S)-tert-butyl (5-benzyl-5-azaspiro[2.4]heptan-7-yl)carbamate

    CAS No.: 144282-37-1
    Catalog No.: 101886
    Purity: 95%
    MF: C18H26N2O2
    MW: 302.418
    Storage: 2-8 degree Celsius
  4. (S)-2-amino-2-(3-chlorophenyl)ethanol

    CAS No.: 663611-73-2
    Catalog No.: 104406
    Purity: 95%
    MF: C8H10ClNO
    MW: 171.627
    Storage: 2-8 degree Celsius
    SMILES: N[C@H](CO)C1=CC=CC(Cl)=C1
  5. (R)-tert-butyl 3-hydroxy-1-phenylpropylcarbamate

    CAS No.: 158807-47-7
    Catalog No.: 105130
    Purity: 95%
    MF: C14H21NO3
    MW: 251.326
    Storage: 2-8 degree Celsius
  6. (R)-3-amino-3-(4-chlorophenyl)propanoic acid

    CAS No.: 131690-61-4
    Catalog No.: 105721
    Purity: 95%
    MF: C9H10ClNO2
    MW: 199.637
    Storage: 2-8 degree Celsius
  7. (R)-2-amino-2-(4-chlorophenyl)acetic acid

    CAS No.: 43189-37-3
    Catalog No.: 105725
    Purity: 95%
    MF: C8H8ClNO2
    MW: 185.61
    Storage: 2-8 degree Celsius
  8. (R)-3-amino-3-(4-fluorophenyl)propan-1-ol

    CAS No.: 228422-47-7
    Catalog No.: 105879
    Purity: 95%
    MF: C9H12FNO
    MW: 169.199
    Storage: 2-8 degree Celsius
  9. (R)-2-amino-2-(4-fluorophenyl)acetic acid

    CAS No.: 93939-74-3
    Catalog No.: 105881
    Purity: 95%
    MF: C8H8FNO2
    MW: 169.155
    Storage: 2-8 degree Celsius
  10. (1R,2R)-1,2-diphenylethane-1,2-diamine

    CAS No.: 35132-20-8
    Catalog No.: 107997
    Purity: 95%
    MF: C14H16N2
    MW: 212.296
    Storage: 2-8 degree Celsius
Loading ...Load More ...
Set Ascending Direction

   

Items 1 to 10 of 981 total

  1. 1
  2. 2
  3. 3
  4. 4
  5. 5