•  
SSL
0item(s)

You have no items in your shopping cart.

Product was successfully added to your shopping cart.

Cell Cycle

Set Ascending Direction

   

Items 41 to 50 of 332 total

  1. 3
  2. 4
  3. 5
  4. 6
  5. 7
  1. C-7280948

    CAS No.: 587850-67-7
    Catalog No.: 111945
    Purity: 95%
    MF: C14H16N2O2S
    MW: 276.361
    Storage: 2-8 degree Celsius
  2. CCT137690

    CAS No.: 1095382-05-0
    Catalog No.: 111842
    Purity: 95%
    MF: C26H31BrN8O
    MW: 551.493
    Storage: 2-8 degree Celsius
  3. Flavopiridol (Alvocidib) HCl

    CAS No.: 131740-09-5
    Catalog No.: 111849
    Purity: 95%
    MF: C21H21Cl2NO5
    MW: 438.307
    Storage: 2-8 degree Celsius
  4. HMN-214

    CAS No.: 173529-46-9
    Catalog No.: 111878
    Purity: 95%
    MF: C22H20N2O5S
    MW: 424.478
    Storage: 2-8 degree Celsius
  5. Inauhzin

    CAS No.: 309271-94-1
    Catalog No.: 112008
    Purity: 95%
    MF: C25H19N5OS2
    MW: 469.595
    Storage: 2-8 degree Celsius
  6. LY2835219

    CAS No.: 1231930-82-7
    Catalog No.: 112001
    Purity: 95%
    MF: C28H36F2N8O3S
    MW: 602.712
    Storage: 2-8 degree Celsius
    SMILES: CS(O)(=O)=O.CCN1CCN(CC2=CN=C(NC3=NC=C(F)C(=N3)C3=CC(F)=C4N=C(C)N(C(C)C)C4=C3)C=C2)CC1
  7. Milciclib; PHA-848125

    CAS No.: 802539-81-7
    Catalog No.: 111897
    Purity: 95%
    MF: C25H32N8O
    MW: 460.586
    Storage: 2-8 degree Celsius
  8. MK-8745

    CAS No.: 885325-71-3
    Catalog No.: 111971
    Purity: 95%
    MF: C20H19ClFN5OS
    MW: 431.924
    Storage: 2-8 degree Celsius
  9. ML167

    CAS No.: 1285702-20-6
    Catalog No.: 111996
    Purity: 95%
    MF: C19H17N3O3
    MW: 335.363
    Storage: 2-8 degree Celsius
  10. PF-3758309

    CAS No.: 898044-15-0
    Catalog No.: 111950
    Purity: 95%
    MF: C25H30N8OS
    MW: 490.637
    Storage: 2-8 degree Celsius
Loading ...Load More ...
Set Ascending Direction

   

Items 41 to 50 of 332 total

  1. 3
  2. 4
  3. 5
  4. 6
  5. 7