•  
SSL
0item(s)

You have no items in your shopping cart.

Product was successfully added to your shopping cart.

Cell Cycle

Set Ascending Direction

   

Items 11 to 20 of 332 total

  1. 1
  2. 2
  3. 3
  4. 4
  5. 5
  1. Palbociclib (PD-0332991; PD 0332991) HCl

    CAS No.: 827022-32-2
    Catalog No.: 105140
    Purity: 95%
    MF: C24H30ClN7O2
    MW: 484.004
    Storage: 2-8 degree Celsius
  2. Pixantrone; Pirodavir; BBR 2778

    CAS No.: 144510-96-3
    Catalog No.: 104831
    Purity: 95%
    MF: C17H19N5O2
    MW: 325.372
    Storage: 2-8 degree Celsius
    SMILES: NCCNC1=C2C(=O)C3=C(C=NC=C3)C(=O)C2=C(NCCN)C=C1
  3. AZD7762

    CAS No.: 860352-01-8
    Catalog No.: 105236
    Purity: 95%
    MF: C17H19FN4O2S
    MW: 362.43
    Storage: 2-8 degree Celsius
  4. TAK-901

    CAS No.: 934541-31-8
    Catalog No.: 104816
    Purity: 95%
    MF: C28H32N4O3S
    MW: 504.656
    Storage: 2-8 degree Celsius
    SMILES: CCS(=O)(=O)C1=CC(=CC=C1)C1=CC(C(=O)NC2CCN(C)CC2)=C(C)C2=C1C1=CC(C)=CN=C1N2
  5. K-Ras(G12C) inhibitor 12

    CAS No.: 1469337-95-8
    Catalog No.: 105456
    Purity: 95%
    MF: C15H17ClIN3O3
    MW: 449.676
    Storage: 2-8 degree Celsius
  6. Talazoparib (8R,9S); BMN-673 8R,9S

    CAS No.: 1207456-00-5
    Catalog No.: 105384
    Purity: 95%
    MF: C19H14F2N6O
    MW: 380.358
    Storage: 2-8 degree Celsius
  7. RKI-1447

    CAS No.: 1342278-01-6
    Catalog No.: 106209
    Purity: 95%
    MF: C16H14N4O2S
    MW: 326.381
    Storage: 2-8 degree Celsius
  8. Pixantrone dimaleate; BBR 2778 dimaleate

    CAS No.: 144675-97-8
    Catalog No.: 108444
    Purity: 95%
    MF: C21H23N5O6
    MW: 441.444
    Storage: 2-8 degree Celsius
    SMILES: OC(=O)\C=C/C(O)=O.NCCNC1=C2C(=O)C3=C(C=NC=C3)C(=O)C2=C(NCCN)C=C1
  9. Podofilox

    CAS No.: 518-28-5
    Catalog No.: 108464
    Purity: 95%
    MF: C22H22O8
    MW: 414.41
    Storage: 2-8 degree Celsius
  10. Poloxin

    CAS No.: 321688-88-4
    Catalog No.: 108467
    Purity: 95%
    MF: C18H19NO3
    MW: 297.354
    Storage: 2-8 degree Celsius
Loading ...Load More ...
Set Ascending Direction

   

Items 11 to 20 of 332 total

  1. 1
  2. 2
  3. 3
  4. 4
  5. 5