•  
SSL
0item(s)

You have no items in your shopping cart.

Product was successfully added to your shopping cart.

CDK

Set Ascending Direction

   

Items 1 to 10 of 72 total

  1. 1
  2. 2
  3. 3
  4. 4
  5. 5
  1. WHI-P180

    CAS No.: 211555-08-7
    Catalog No.: 153287
    Purity: 95%
    MF: C16H15N3O3
    MW: 297.314
    Storage: 2-8 degree Celsius
    SMILES: COC1=C(OC)C=C2C(NC3=CC=CC(O)=C3)=NC=NC2=C1
  2. THZ2

    CAS No.: 1604810-84-5
    Catalog No.: 186180
    Purity: 95%
    MF: C31H28ClN7O2
    MW: 566.065
    Storage: 2-8 degree Celsius
    SMILES: ClC=1C(=NC(=NC1)NC=1C=C(C=CC1)NC(C1=CC(=CC=C1)NC(\C=C\CN(C)C)=O)=O)C1=CNC2=CC=CC=C12
  3. RGB-286638

    CAS No.: 784210-87-3
    Catalog No.: 186153
    Purity: 95%
    MF: C29H37Cl2N7O4
    MW: 618.566
    Storage: 2-8 degree Celsius
    SMILES: Cl.Cl.COCCN1CCN(CC1)CC1=CC=C(C=C1)C=1C2=C(NN1)C1=CC=CC(=C1C2=O)NC(=O)NN2CCOCC2
  4. P276-00

    CAS No.: 920113-03-7
    Catalog No.: 186136
    Purity: 95%
    MF: C21H21Cl2NO5
    MW: 438.307
    Storage: 2-8 degree Celsius
    SMILES: Cl.ClC1=C(C=CC=C1)C=1OC2=C(C(=CC(=C2C(C1)=O)O)O)[C@H]1[C@@H](N(CC1)C)CO
  5. NVP-LCQ195

    CAS No.: 902156-99-4
    Catalog No.: 178979
    Purity: 95%
    MF: C17H19Cl2N5O4S
    MW: 460.343
    Storage: 2-8 degree Celsius
    SMILES: CS(=O)(=O)N1CCC(CC1)NC(=O)C1=NNC=C1NC(=O)C1=C(Cl)C=CC=C1Cl
  6. CDK9-IN-2

    CAS No.: 1263369-28-3
    Catalog No.: 178741
    Purity: 95%
    MF: C23H25ClFN5
    MW: 425.939
    Storage: 2-8 degree Celsius
    SMILES: N[C@H]1CC[C@@H](CC1)NC1=NC=C(Cl)C(=C1)C1=NC(NCC2=CC=CC(F)=C2)=CC=C1
  7. M2I-1

    CAS No.: 312271-03-7
    Catalog No.: 171852
    Purity: 95%
    MF: C19H24N4O4S
    MW: 404.492
    Storage: 2-8 degree Celsius
    SMILES: CC(C)CN(CC(C)C)C1=C(C=C(C=C2C(=O)NC(=S)NC2=O)C=C1)[N+]([O-])=O
  8. BS-181

    CAS No.: 1092443-52-1
    Catalog No.: 169639
    Purity: 95%
    MF: C22H32N6
    MW: 380.54
    Storage: 2-8 degree Celsius
    SMILES: CC(C)C1=C2N=C(NCCCCCCN)C=C(NCC3=CC=CC=C3)N2N=C1
  9. RGB-286638 free base

    CAS No.: 784210-88-4
    Catalog No.: 169473
    Purity: 95%
    MF: C29H35N7O4
    MW: 545.644
    Storage: 2-8 degree Celsius
    SMILES: COCCN1CCN(CC2=CC=C(C=C2)C2=NNC3=C2C(=O)C2=C(NC(=O)NN4CCOCC4)C=CC=C32)CC1
  10. CDKI-73

    CAS No.: 1421693-22-2
    Catalog No.: 186181
    Purity: 95%
    MF: C15H15FN6O2S2
    MW: 394.457
    Storage: 2-8 degree Celsius
    SMILES: FC=1C(=NC(=NC1)NC=1C=C(C=CC1)S(=O)(=O)N)C1=C(N=C(S1)NC)C
Loading ...Load More ...
Set Ascending Direction

   

Items 1 to 10 of 72 total

  1. 1
  2. 2
  3. 3
  4. 4
  5. 5