•  
SSL
0item(s)

You have no items in your shopping cart.

Product was successfully added to your shopping cart.

Carbazoles

Set Descending Direction

   

Items 1 to 10 of 197 total

  1. 1
  2. 2
  3. 3
  4. 4
  5. 5
  1. 3-iodo-N-phenylcarbazole

    CAS No.: 502161-03-7
    Catalog No.: 101168
    Purity: 95%
    MF: C18H12IN
    MW: 369.205
    Storage: 2-8 degree Celsius
    SMILES: IC1=CC2=C(C=C1)N(C1=C2C=CC=C1)C1=CC=CC=C1
  2. 6-fluoro-2,3,4,9-tetrahydro-1H-carbazol-2-amine

    CAS No.: 907211-97-6
    Catalog No.: 101363
    Purity: 95%
    MF: C12H13FN2
    MW: 204.248
    Storage: 2-8 degree Celsius
  3. 2,3,4,9-tetrahydro-1H-carbazol-2-amine

    CAS No.: 72898-07-8
    Catalog No.: 101364
    Purity: 95%
    MF: C12H14N2
    MW: 186.258
    Storage: 2-8 degree Celsius
    SMILES: NC1CCC2=C(C1)NC1=C2C=CC=C1
  4. 2-tert-butylspiro[indene-1,4'-piperidine]-1'-carboxylic acid

    CAS No.: 137419-24-0
    Catalog No.: 102625
    Purity: 95%
    MF: C18H23NO2
    MW: 285.387
    Storage: 2-8 degree Celsius
  5. ethyl 5,11-dihydroindolo[3,2-b]carbazole-6-carboxylate

    CAS No.: 229020-86-4
    Catalog No.: 103019
    Purity: 95%
    MF: C21H16N2O2
    MW: 328.371
    Storage: 2-8 degree Celsius
    SMILES: CCOC(=O)C1=C2C(NC3=C2C=CC=C3)=CC2=C1NC1=C2C=CC=C1
  6. (9H-carbazol-9-yl)(phenyl)methanone

    CAS No.: 19264-68-7
    Catalog No.: 103463
    Purity: 95%
    MF: C19H13NO
    MW: 271.319
    Storage: 2-8 degree Celsius
  7. 5,7-dihydroindolo[2,3-b]carbazole

    CAS No.: 111296-90-3
    Catalog No.: 105784
    Purity: 95%
    MF: C18H12N2
    MW: 256.308
    Storage: 2-8 degree Celsius
  8. 11,12-dihydroindolo[2,3-a]carbazole

    CAS No.: 60511-85-5
    Catalog No.: 105951
    Purity: 95%
    MF: C18H12N2
    MW: 256.308
    Storage: 2-8 degree Celsius
    SMILES: N1C2=C(C=CC=C2)C2=C1C1=C(C=C2)C2=C(N1)C=CC=C2
  9. 3,4-dihydro-1H-carbazol-2(9H)-one

    CAS No.: 40429-00-3
    Catalog No.: 106280
    Purity: 95%
    MF: C12H11NO
    MW: 185.226
    Storage: 2-8 degree Celsius
  10. (Z)-3,4-dihydro-1H-carbazol-2(9H)-one oxime

    CAS No.: 91391-95-6
    Catalog No.: 106281
    Purity: 95%
    MF: C12H12N2O
    MW: 200.241
    Storage: 2-8 degree Celsius
    SMILES: O\N=C1\CCC2=C(C1)NC1=C2C=CC=C1
Loading ...Load More ...
Set Descending Direction

   

Items 1 to 10 of 197 total

  1. 1
  2. 2
  3. 3
  4. 4
  5. 5