•  
SSL
0item(s)

You have no items in your shopping cart.

Product was successfully added to your shopping cart.

Calcium Channel

Set Descending Direction

   

Items 1 to 10 of 39 total

  1. 1
  2. 2
  3. 3
  4. 4
  1. Nicardipine

    CAS No.: 55985-32-5
    Catalog No.: 187919
    Purity: 95%
    MF: C26H29N3O6
    MW: 479.533
    Storage: 2-8 degree Celsius
    SMILES: CC=1NC(=C(C(C1C(=O)OCCN(C)CC1=CC=CC=C1)C1=CC(=CC=C1)[N+](=O)[O-])C(=O)OC)C
  2. Diltiazem HCl

    CAS No.: 33286-22-5
    Catalog No.: 151527
    Purity: 95%
    MF: C22H27ClN2O4S
    MW: 450.988
    Storage: 2-8 degree Celsius
    SMILES: Cl.COC1=CC=C(C=C1)[C@@H]1SC2=C(C=CC=C2)N(CCN(C)C)C(=O)[C@@H]1OC(C)=O
  3. Levetiracetam

    CAS No.: 102767-28-2
    Catalog No.: 151417
    Purity: 95%
    MF: C8H14N2O2
    MW: 170.212
    Storage: 2-8 degree Celsius
    SMILES: CC[C@H](N1CCCC1=O)C(N)=O
  4. Bay K 8644

    CAS No.: 71145-03-4
    Catalog No.: 152123
    Purity: 95%
    MF: C16H15F3N2O4
    MW: 356.3
    Storage: 2-8 degree Celsius
    SMILES: COC(=O)C1=C(C)NC(C)=C(C1C1=C(C=CC=C1)C(F)(F)F)[N+]([O-])=O
  5. Cinepazide maleate

    CAS No.: 26328-04-1
    Catalog No.: 151801
    Purity: 95%
    MF: C26H35N3O9
    MW: 533.578
    Storage: 2-8 degree Celsius
    SMILES: OC(=O)\C=C/C(O)=O.COC1=CC(\C=C\C(=O)N2CCN(CC(=O)N3CCCC3)CC2)=CC(OC)=C1OC
  6. Econazole nitrate

    CAS No.: 24169-02-6
    Catalog No.: 151718
    Purity: 95%
    MF: C18H15Cl3N3O4-
    MW: 443.694
    Storage: 2-8 degree Celsius
    SMILES: [O-][N+]([O-])=O.ClC1=CC=C(COC(CN2C=CN=C2)C2=C(Cl)C=C(Cl)C=C2)C=C1
  7. SKF96365

    CAS No.: 130495-35-1
    Catalog No.: 152145
    Purity: 95%
    MF: C22H27ClN2O3
    MW: 402.922
    Storage: 2-8 degree Celsius
    SMILES: Cl.COC1=CC=C(CCCOC(CN2C=CN=C2)C2=CC=C(OC)C=C2)C=C1
  8. Tetracaine HCl

    CAS No.: 136-47-0
    Catalog No.: 151733
    Purity: 95%
    MF: C15H25ClN2O2
    MW: 300.83
    Storage: 2-8 degree Celsius
    SMILES: Cl.CCCCNC1=CC=C(C=C1)C(=O)OCCN(C)C
  9. Tetrandrine

    CAS No.: 518-34-3
    Catalog No.: 151675
    Purity: 95%
    MF: C38H42N2O6
    MW: 622.762
    Storage: 2-8 degree Celsius
    SMILES: [H][C@@]12CC3=CC=C(OC4=CC(C[C@]5([H])N(C)CCC6=C5C(OC5=C(OC)C=C(CCN1C)C2=C5)=C(OC)C(OC)=C6)=CC=C4OC)C=C3
  10. MK-8998

    CAS No.: 953778-58-0
    Catalog No.: 186234
    Purity: 95%
    MF: C20H23F3N2O2
    MW: 380.41
    Storage: 2-8 degree Celsius
    SMILES: C(C)(C)C1=CC=C(C=C1)CC(=O)N[C@H](C)C1=NC=C(C=C1)OCC(F)(F)F
Loading ...Load More ...
Set Descending Direction

   

Items 1 to 10 of 39 total

  1. 1
  2. 2
  3. 3
  4. 4