•  
SSL
0item(s)

You have no items in your shopping cart.

Product was successfully added to your shopping cart.

c-Met

Set Descending Direction

   

Items 1 to 10 of 27 total

  1. 1
  2. 2
  3. 3
  1. NVP-BVU972

    CAS No.: 1185763-69-2
    Catalog No.: 111875
    Purity: 95%
    MF: C20H16N6
    MW: 340.39
    Storage: 2-8 degree Celsius
  2. Capmatinib Hydrochloride Hydrate

    CAS No.: 1865733-40-9
    Catalog No.: WLZ3840
    Purity: 95%
    MF: C23H20ClFN6O2
    MW: 466.904
    Storage: 2-8 degree Celsius
    SMILES: Cl.O.FC1=C(C(=O)NC)C=CC(=C1)C=1C=NC=2N(N1)C(=CN2)CC=2C=C1C=CC=NC1=CC2
  3. Zongertinib

    CAS No.: 2728667-27-2
    Catalog No.: WLZ3778
    Purity: 95%
    MF: C29H29N9O2
    MW: 535.612
    Storage: 2-8 degree Celsius
    SMILES: CC=1C=C(C=CC1OC1=CC2=C(N(C=N2)C)C=C1)NC1=NC=NC2=C1N=C(N=C2)N2CCC(CC2)NC(C=C)=O
  4. Glumetinib

    CAS No.: 1642581-63-2
    Catalog No.: WLZ0033
    Purity: 95%
    MF: C21H17N9O2S
    MW: 459.495
    Storage: 2-8 degree Celsius
    SMILES: CN1N=CC(=C1)C=1C=C2C(=NC1)C=NN2S(=O)(=O)C2=CN=C1N2C=C(C=C1)C=1C=NN(C1)C
  5. c-met inhibitor 2/SCR-1481B1

    CAS No.: 1174161-86-4
    Catalog No.: 169631
    Purity: 95%
    MF: C28H26ClF2N5O9P-
    MW: 680.965
    Storage: 2-8 degree Celsius
    SMILES: NC1=NC=CC(OC2=C(F)C=C(NC(=O)C3=CN(COP([O-])(=O)OCC(N)(CO)CO)C=C(C3=O)C3=CC=C(F)C=C3)C=C2)=C1Cl
  6. Tyrosine kinase inhibitor

    CAS No.: 1021950-26-4
    Catalog No.: 156642
    Purity: 95%
    MF: C31H31FN6O5
    MW: 586.624
    Storage: 2-8 degree Celsius
    SMILES: FC1=CC=C(NC(=O)C2(CC2)C(=O)NC2=CC=C(OC3=CC=NC4=C3C=C(N4)C(=O)NCCN3CCOCC3)C=C2)C=C1
  7. Savolitinib

    CAS No.: 1313725-88-0
    Catalog No.: 153871
    Purity: 95%
    MF: C17H15N9
    MW: 345.37
    Storage: 2-8 degree Celsius
    SMILES: C[C@H](N1N=NC2=NC=C(N=C12)C1=CN(C)N=C1)C1=CN2C=CN=C2C=C1
  8. AMG 337

    CAS No.: 1173699-31-4
    Catalog No.: 152175
    Purity: 95%
    MF: C23H22FN7O3
    MW: 463.473
    Storage: 2-8 degree Celsius
    SMILES: COCCOC1=CN=C2C=CN([C@H](C)C3=NN=C4N3C=C(C=C4F)C3=CN(C)N=C3)C(=O)C2=C1
  9. BMS-794833

    CAS No.: 1174046-72-0
    Catalog No.: 141521
    Purity: 95%
    MF: C23H15ClF2N4O3
    MW: 468.847
    Storage: 2-8 degree Celsius
    SMILES: NC1=NC=CC(OC2=C(F)C=C(NC(=O)C3=CNC=C(C3=O)C3=CC=C(F)C=C3)C=C2)=C1Cl
  10. Capmatinib 2HCl( INCB28060 2HCl)

    CAS No.: 1197376-85-4
    Catalog No.: 141002
    Purity: 95%
    MF: C23H19Cl2FN6O
    MW: 485.35
    Storage: 2-8 degree Celsius
    SMILES: Cl.Cl.CNC(=O)C1=C(F)C=C(C=C1)C1=NN2C(CC3=CC=C4N=CC=CC4=C3)=CN=C2N=C1
Loading ...Load More ...
Set Descending Direction

   

Items 1 to 10 of 27 total

  1. 1
  2. 2
  3. 3