•  
SSL
0item(s)

You have no items in your shopping cart.

Product was successfully added to your shopping cart.

Building Blocks

Set Descending Direction

   

Items 51 to 60 of 31798 total

  1. 4
  2. 5
  3. 6
  4. 7
  5. 8
  1. methyl 4-(pyrrolidin-3-yl)benzoate

    CAS No.: 1203797-98-1
    Catalog No.: GS0756
    Purity: 95%
    MF: C12H15NO2
    MW: 205.257
    Storage: 2-8 degree Celsius
    SMILES: N1CC(CC1)C1=CC=C(C(=O)OC)C=C1
  2. 3-chloro-5-methoxybenzenesulfonamide

    CAS No.: 1261557-62-3
    Catalog No.: GS1044
    Purity: 95%
    MF: C7H8ClNO3S
    MW: 221.665
    Storage: 2-8 degree Celsius
    SMILES: ClC=1C=C(C=C(C1)OC)S(=O)(=O)N
  3. 1-(6-(trifluoromethyl)pyridin-3-yl)piperazine

    CAS No.: 845617-30-3
    Catalog No.: GS0836
    Purity: 95%
    MF: C10H12F3N3
    MW: 231.221
    Storage: 2-8 degree Celsius
    SMILES: FC(C1=CC=C(C=N1)N1CCNCC1)(F)F
  4. 1-(6-methylpyridin-3-yl)piperazine

    CAS No.: 845617-33-6
    Catalog No.: GS0829
    Purity: 95%
    MF: C10H15N3
    MW: 177.251
    Storage: 2-8 degree Celsius
    SMILES: CC1=CC=C(C=N1)N1CCNCC1
  5. 1-(5-nitropyridin-3-yl)piperazine

    CAS No.: 1211533-68-4
    Catalog No.: GS0823
    Purity: 95%
    MF: C9H12N4O2
    MW: 208.221
    Storage: 2-8 degree Celsius
    SMILES: [N+](=O)([O-])C=1C=C(C=NC1)N1CCNCC1
  6. 3-(piperazin-1-yl)pyridin-4-amine

    CAS No.: 1268025-92-8
    Catalog No.: GS0815
    Purity: 95%
    MF: C9H14N4
    MW: 178.239
    Storage: 2-8 degree Celsius
    SMILES: N1(CCNCC1)C=1C=NC=CC1N
  7. 3-(piperazin-1-yl)pyridin-2-amine

    CAS No.: 1565534-81-7
    Catalog No.: GS0806
    Purity: 95%
    MF: C9H14N4
    MW: 178.239
    Storage: 2-8 degree Celsius
    SMILES: N1(CCNCC1)C=1C(=NC=CC1)N
  8. methyl 4-(pyrrolidin-3-yl)benzoate hydrochloride

    CAS No.: 1203683-93-5
    Catalog No.: GS0757
    Purity: 95%
    MF: C12H16ClNO2
    MW: 241.718
    Storage: 2-8 degree Celsius
    SMILES: Cl.N1CC(CC1)C1=CC=C(C(=O)OC)C=C1
  9. 5-(azetidin-3-yl)pyridin-2-amine

    CAS No.: 1260847-13-9
    Catalog No.: GS0706
    Purity: 95%
    MF: C8H11N3
    MW: 149.197
    Storage: 2-8 degree Celsius
    SMILES: N1CC(C1)C=1C=CC(=NC1)N
  10. 5-(azetidin-3-yl)-2-(trifluoromethyl)pyridine

    CAS No.: 1260846-05-6
    Catalog No.: GS0708
    Purity: 95%
    MF: C9H9F3N2
    MW: 202.179
    Storage: 2-8 degree Celsius
    SMILES: N1CC(C1)C=1C=CC(=NC1)C(F)(F)F
Loading ...Load More ...
Set Descending Direction

   

Items 51 to 60 of 31798 total

  1. 4
  2. 5
  3. 6
  4. 7
  5. 8