•  
SSL
0item(s)

You have no items in your shopping cart.

Product was successfully added to your shopping cart.

Building Blocks

Set Descending Direction

   

Items 1 to 10 of 88713 total

  1. 1
  2. 2
  3. 3
  4. 4
  5. 5
  1. methyl 3-bromo-5-(hydroxymethyl)benzoate

    CAS No.: 307353-32-8
    Catalog No.: 126737
    Purity: 95%
    MF: C9H9BrO3
    MW: 245.072
    Storage: 2-8 degree Celsius
    SMILES: COC(=O)C1=CC(CO)=CC(Br)=C1
  2. 3-(4-bromophenyl)-3-(trifluoromethyl)-3H-diazirine

    CAS No.: 952143-02-1
    Catalog No.: TQ0144
    Purity: 95%
    MF: C8H4BrF3N2
    MW: 265.032
    Storage: 2-8 degree Celsius
    SMILES: BrC1=CC=C(C=C1)C1(N=N1)C(F)(F)F
  3. Flurpiridaz

    CAS No.: 863888-33-9
    Catalog No.: TQP0454
    Purity: 95%
    MF: C18H22ClFN2O3
    MW: 368.836
    Storage: 2-8 degree Celsius
    SMILES: C(C)(C)(C)N1N=CC(=C(C1=O)Cl)OCC1=CC=C(C=C1)COCCF
  4. 3,5-dimethyl-2-iodophenol

    CAS No.: 24242-79-3
    Catalog No.: HKP0195
    Purity: 95%
    MF: C8H9IO
    MW: 248.063
    Storage: 2-8 degree Celsius
    SMILES: CC=1C(=C(C=C(C1)C)O)I
  5. Mequindox

    CAS No.: 60875-16-3
    Catalog No.: 100561
    Purity: 95%
    MF: C11H10N2O3
    MW: 218.212
    Storage: 2-8 degree Celsius
    SMILES: CC1=NN(C(=O)C1)C1=CC=C(C=C1)C(O)=O
  6. 4,6-dichloronicotinaldehyde

    CAS No.: 1060811-62-2
    Catalog No.: 100001
    Purity: 95%
    MF: C6H3Cl2NO
    MW: 176.002
    Storage: 2-8 degree Celsius
    SMILES: ClC1=NC=C(C=O)C(Cl)=C1
  7. 2,4-dichloronicotinaldehyde

    CAS No.: 134031-24-6
    Catalog No.: 100002
    Purity: 95%
    MF: C6H3Cl2NO
    MW: 176.002
    Storage: 2-8 degree Celsius
    SMILES: ClC1=CC=NC(Cl)=C1C=O
  8. 5-bromo-2-chloroisonicotinaldehyde

    CAS No.: 1060802-23-4
    Catalog No.: 100003
    Purity: 95%
    MF: C6H3BrClNO
    MW: 220.453
    Storage: 2-8 degree Celsius
    SMILES: ClC1=CC(C=O)=C(Br)C=N1
  9. 2-chloro-5-fluoropyridin-4-amine

    CAS No.: 89510-90-7
    Catalog No.: 100004
    Purity: 95%
    MF: C5H4ClFN2
    MW: 146.552
    Storage: 2-8 degree Celsius
    SMILES: NC1=CC(Cl)=NC=C1F
  10. 2-chloro-5-fluoro-3-nitropyridin-4-amine

    CAS No.: 405230-90-2
    Catalog No.: 100005
    Purity: 95%
    MF: C5H3ClFN3O2
    MW: 191.549
    Storage: 2-8 degree Celsius
    SMILES: NC1=C(C(Cl)=NC=C1F)[N+]([O-])=O
Loading ...Load More ...
Set Descending Direction

   

Items 1 to 10 of 88713 total

  1. 1
  2. 2
  3. 3
  4. 4
  5. 5