•  
SSL
0item(s)

You have no items in your shopping cart.

Product was successfully added to your shopping cart.

Bicycloes

Set Descending Direction

   

Items 11 to 20 of 106 total

  1. 1
  2. 2
  3. 3
  4. 4
  5. 5
  1. methyl 3-aminobicyclo[1.1.1]pentane-1-carboxylate

    CAS No.: 758684-88-7
    Catalog No.: 193451
    Purity: 95%
    MF: C7H11NO2
    MW: 141.17
    Storage: 2-8 degree Celsius
    SMILES: NC12CC(C1)(C2)C(=O)OC
  2. tert-butyl 3,6-diazabicyclo[3.1.1]heptane-6-carboxylate hydrochloride

    CAS No.: 1384424-52-5
    Catalog No.: ZB2071
    Purity: 95%
    MF: C10H19ClN2O2
    MW: 234.727
    Storage: 2-8 degree Celsius
    SMILES: Cl.C12CNCC(N1C(=O)OC(C)(C)C)C2
  3. exo-7-oxabicyclo[2.2.1]heptane-2,3-dicarboxylic anhydride

    CAS No.: 29745-04-8
    Catalog No.: 184227
    Purity: 95%
    MF: C8H8O4
    MW: 168.148
    Storage: 2-8 degree Celsius
    SMILES: O=C1OC(=O)C2C3CCC(O3)C12
  4. bicyclo[1.1.1]pentan-1-amine hydrochloride

    CAS No.: 22287-35-0
    Catalog No.: 184576
    Purity: 95%
    MF: C5H10ClN
    MW: 119.595
    Storage: 2-8 degree Celsius
    SMILES: Cl.NC12CC(C1)C2
  5. tert-butyl (3-cyanobicyclo[1.1.1]pentan-1-yl)carbamate

    CAS No.: 2170371-89-6
    Catalog No.: 184580
    Purity: 95%
    MF: C11H16N2O2
    MW: 208.261
    Storage: 2-8 degree Celsius
    SMILES: CC(C)(C)OC(=O)NC12CC(C1)(C2)C#N
  6. 3-fluorobicyclo[1.1.1]pentan-1-amine hydrochloride

    CAS No.: 1826900-79-1
    Catalog No.: 184582
    Purity: 95%
    MF: C5H9ClFN
    MW: 137.585
    Storage: 2-8 degree Celsius
    SMILES: Cl.NC12CC(F)(C1)C2
  7. 1-(trifluoromethyl)bicyclo[1.1.1]pentan-3-amine hydrochloride

    CAS No.: 262852-11-9
    Catalog No.: 184583
    Purity: 95%
    MF: C6H9ClF3N
    MW: 187.592
    Storage: 2-8 degree Celsius
    SMILES: Cl.NC12CC(C1)(C2)C(F)(F)F
  8. tert-butyl (3-aminobicyclo[1.1.1]pentan-1-yl)carbamate

    CAS No.: 1638767-25-5
    Catalog No.: 184584
    Purity: 95%
    MF: C10H18N2O2
    MW: 198.266
    Storage: 2-8 degree Celsius
    SMILES: CC(C)(C)OC(=O)NC12CC(N)(C1)C2
  9. tert-butyl (3-(trifluoromethyl)bicyclo[1.1.1]pentan-1-yl)carbamate

    CAS No.: 1886967-53-8
    Catalog No.: 184585
    Purity: 95%
    MF: C11H16F3NO2
    MW: 251.248
    Storage: 2-8 degree Celsius
    SMILES: CC(C)(C)OC(=O)NC12CC(C1)(C2)C(F)(F)F
  10. 1-(3-acetyl-1-bicyclo[1.1.1]pentanyl)ethanone

    CAS No.: 115913-30-9
    Catalog No.: 184587
    Purity: 95%
    MF: C9H12O2
    MW: 152.193
    Storage: 2-8 degree Celsius
    SMILES: CC(=O)C12CC(C1)(C2)C(C)=O
Loading ...Load More ...
Set Descending Direction

   

Items 11 to 20 of 106 total

  1. 1
  2. 2
  3. 3
  4. 4
  5. 5