•  
SSL
0item(s)

You have no items in your shopping cart.

Product was successfully added to your shopping cart.

Bicycloes

Set Descending Direction

   

Items 1 to 10 of 106 total

  1. 1
  2. 2
  3. 3
  4. 4
  5. 5
  1. tert-butyl (3-(hydroxymethyl)bicyclo[1.1.1]pentan-1-yl)carbamate

    CAS No.: 1638765-26-0
    Catalog No.: 182898
    Purity: 95%
    MF: C11H19NO3
    MW: 213.277
    Storage: 2-8 degree Celsius
    SMILES: CC(C)(C)OC(=O)NC12CC(CO)(C1)C2
  2. tert-butyl (3-formylbicyclo[1.1.1]pentan-1-yl)carbamate

    CAS No.: 1638771-06-8
    Catalog No.: 182899
    Purity: 95%
    MF: C11H17NO3
    MW: 211.261
    Storage: 2-8 degree Celsius
    SMILES: CC(C)(C)OC(=O)NC12CC(C1)(C2)C=O
  3. bicyclo[3.1.0]hexan-3-amine hydrochloride

    CAS No.: 89676-80-2
    Catalog No.: 187433
    Purity: 95%
    MF: C6H12ClN
    MW: 133.622
    Storage: -20 degree Celsius
    SMILES: Cl.C12CC(CC2C1)N
  4. 3-(((tert-butyldimethylsilyl)oxy)methyl)bicyclo[1.1.1]pentane-1-carboxylic acid

    CAS No.: 2095495-84-2
    Catalog No.: 182894
    Purity: 95%
    MF: C13H24O3Si
    MW: 256.418
    Storage: 2-8 degree Celsius
    SMILES: CC(C)(C)[Si](C)(C)OCC12CC(C1)(C2)C(O)=O
  5. 3-(hydroxymethyl)bicyclo[1.1.1]pentan-1-yl benzoate

    CAS No.: 2095495-86-4
    Catalog No.: 182895
    Purity: 95%
    MF: C13H14O3
    MW: 218.252
    Storage: 2-8 degree Celsius
    SMILES: OCC12CC(C1)(C2)OC(=O)C1=CC=CC=C1
  6. 3-formylbicyclo[1.1.1]pentan-1-yl benzoate

    CAS No.: 2095495-87-5
    Catalog No.: 182896
    Purity: 95%
    MF: C13H12O3
    MW: 216.236
    Storage: 2-8 degree Celsius
    SMILES: O=CC12CC(C1)(C2)OC(=O)C1=CC=CC=C1
  7. 3-(((tert-butyldimethylsilyl)oxy)methyl)bicyclo[1.1.1]pentane-1-carbaldehyde

    CAS No.: 2136607-41-3
    Catalog No.: 182902
    Purity: 95%
    MF: C13H24O2Si
    MW: 240.419
    Storage: 2-8 degree Celsius
    SMILES: CC(C)(C)[Si](C)(C)OCC12CC(C1)(C2)C=O
  8. methyl 3-formylbicyclo[1.1.1]pentane-1-carboxylate

    CAS No.: 180464-92-0
    Catalog No.: 182903
    Purity: 95%
    MF: C8H10O3
    MW: 154.165
    Storage: 2-8 degree Celsius
    SMILES: COC(=O)C12CC(C1)(C2)C=O
  9. bicyclo[3.1.0]hexan-3-amine

    CAS No.: 79531-79-6
    Catalog No.: 187513
    Purity: 95%
    MF: C6H11N
    MW: 97.161
    Storage: -20 degree Celsius
    SMILES: C12CC(CC2C1)N
  10. (1R,2R,3R,6S)-3-isopropyl-6-methyl-7-oxabicyclo[4.1.0]heptan-2-ol

    CAS No.: 103476-53-5
    Catalog No.: 192444
    Purity: 95%
    MF: C10H18O2
    MW: 170.252
    Storage: 2-8 degree Celsius
    SMILES: C(C)(C)[C@@H]1[C@H]([C@H]2O[C@]2(CC1)C)O
Loading ...Load More ...
Set Descending Direction

   

Items 1 to 10 of 106 total

  1. 1
  2. 2
  3. 3
  4. 4
  5. 5