•  
SSL
0item(s)

You have no items in your shopping cart.

Product was successfully added to your shopping cart.

Bicycloes

Set Ascending Direction

   

Items 1 to 10 of 69 total

  1. 1
  2. 2
  3. 3
  4. 4
  5. 5
  1. methyl 3-bromobicyclo[1.1.1]pentane-1-carboxylate

    CAS No.: 83249-14-3
    Catalog No.: 186824
    Purity: 95%
    MF: C7H9BrO2
    MW: 205.051
    Storage: 2-8 degree Celsius
    SMILES: BrC12CC(C1)(C2)C(=O)OC
  2. 3-(hydroxymethyl)bicyclo[1.1.1]pentan-1-yl benzoate

    CAS No.: 2095495-86-4
    Catalog No.: 182895
    Purity: 95%
    MF: C13H14O3
    MW: 218.252
    Storage: 2-8 degree Celsius
    SMILES: OCC12CC(C1)(C2)OC(=O)C1=CC=CC=C1
  3. 3-(((tert-butyldimethylsilyl)oxy)methyl)bicyclo[1.1.1]pentane-1-carboxylic acid

    CAS No.: 2095495-84-2
    Catalog No.: 182894
    Purity: 95%
    MF: C13H24O3Si
    MW: 256.418
    Storage: 2-8 degree Celsius
    SMILES: CC(C)(C)[Si](C)(C)OCC12CC(C1)(C2)C(O)=O
  4. 5,5-difluoro-2-aza-Bicyclo[2.2.1]heptane hydrochloride

    CAS No.: 1783656-28-9
    Catalog No.: 199852
    Purity: 95%
    MF: C6H10ClF2N
    MW: 169.602
    Storage: 2-8 degree Celsius
    SMILES: Cl.FC1(C2CNC(C1)C2)F
  5. Adamantane-1-carboximidamide

    CAS No.: 173601-35-9
    Catalog No.: 195416
    Purity: 95%
    MF: C11H18N2
    MW: 178.279
    Storage: 2-8 degree Celsius
    SMILES: N=C(C12CC3CC(C2)CC(C3)C1)N
  6. 2,2'-(((1R,2R,3R,5S)-2,6,6-trimethylbicyclo[3.1.1]heptan-3-yl)azanediyl)diacetic acid

    CAS No.: 1330780-51-2
    Catalog No.: 194357
    Purity: 95%
    MF: C14H23NO4
    MW: 269.341
    Storage: 2-8 degree Celsius
    SMILES: C[C@@H]1[C@@H]2C([C@H](C[C@H]1N(CC(=O)O)CC(=O)O)C2)(C)C
  7. 3-bromobicyclo[2.1.0]pentane-1-carboxylic acid

    CAS No.: 2386560-87-6
    Catalog No.: 193334
    Purity: 95%
    MF: C6H7BrO2
    MW: 191.024
    Storage: 2-8 degree Celsius
    SMILES: BrC1CC2(CC12)C(=O)O
  8. (1R)-(+)-Nopinone

    CAS No.: 38651-65-9
    Catalog No.: 189237
    Purity: 95%
    MF: C9H14O
    MW: 138.21
    Storage: 2-8 degree Celsius
    SMILES: CC1([C@H]2CCC([C@@H]1C2)=O)C
  9. 3-aminonoradamantane hydrochloride

    CAS No.: 86128-83-8
    Catalog No.: 187571
    Purity: 95%
    MF: C9H16ClN
    MW: 173.687
    Storage: 2-8 degree Celsius
    SMILES: Cl.C1C2CC3(CC(CC13)C2)N
  10. 3-formylbicyclo[1.1.1]pentan-1-yl benzoate

    CAS No.: 2095495-87-5
    Catalog No.: 182896
    Purity: 95%
    MF: C13H12O3
    MW: 216.236
    Storage: 2-8 degree Celsius
    SMILES: O=CC12CC(C1)(C2)OC(=O)C1=CC=CC=C1
Loading ...Load More ...
Set Ascending Direction

   

Items 1 to 10 of 69 total

  1. 1
  2. 2
  3. 3
  4. 4
  5. 5