•  
SSL
0item(s)

You have no items in your shopping cart.

Product was successfully added to your shopping cart.

Benzoxazoles

Set Descending Direction

   

Items 1 to 10 of 291 total

  1. 1
  2. 2
  3. 3
  4. 4
  5. 5
  1. 6-nitro-1,3-benzoxazole

    CAS No.: 17200-30-5
    Catalog No.: 101133
    Purity: 95%
    MF: C7H4N2O3
    MW: 164.12
    Storage: 2-8 degree Celsius
    SMILES: [O-][N+](=O)C1=CC=C2N=COC2=C1
  2. 2,1-benzisoxazole-3-carboxylic acid

    CAS No.: 642-91-1
    Catalog No.: 101134
    Purity: 95%
    MF: C8H5NO3
    MW: 163.132
    Storage: 2-8 degree Celsius
    SMILES: OC(=O)C1=C2C=CC=CC2=NO1
  3. 4-chlorobenzo[c][1,2,5]oxadiazole

    CAS No.: 7116-16-7
    Catalog No.: 101848
    Purity: 95%
    MF: C6H3ClN2O
    MW: 154.556
    Storage: 2-8 degree Celsius
    SMILES: ClC1=CC=CC2=NON=C12
  4. 4-fluoro-7-nitrobenzo[c][1,2,5]oxadiazole

    CAS No.: 29270-56-2
    Catalog No.: 101849
    Purity: 95%
    MF: C6H2FN3O3
    MW: 183.098
    Storage: 2-8 degree Celsius
    SMILES: [O-][N+](=O)C1=CC=C(F)C2=NON=C12
  5. 5-bromo-2,1,3-benzoxadiazole

    CAS No.: 51376-06-8
    Catalog No.: 101850
    Purity: 95%
    MF: C6H3BrN2O
    MW: 199.007
    Storage: 2-8 degree Celsius
  6. benzo[c][1,2,5]oxadiazol-5-ylboronic acid

    CAS No.: 426268-09-9
    Catalog No.: 101882
    Purity: 95%
    MF: C6H5BN2O3
    MW: 163.929
    Storage: 2-8 degree Celsius
    SMILES: OB(O)C1=CC2=NON=C2C=C1
  7. 3-methyl-2-((1-(3-(trimethylAmmonio)propyl)pyridin-4(1H)-ylidene)methyl)benzo[d]oxazol-3-ium iodide

    CAS No.: 157199-56-9
    Catalog No.: 102506
    Purity: 95%
    MF: C20H27I2N3O
    MW: 579.264
    Storage: 2-8 degree Celsius
  8. 7-bromobenzo[d]oxazol-2(3H)-one

    CAS No.: 871367-14-5
    Catalog No.: 102768
    Purity: 95%
    MF: C7H4BrNO2
    MW: 214.018
    Storage: 2-8 degree Celsius
  9. 6-bromobenzo[d]oxazole

    CAS No.: 375369-14-5
    Catalog No.: 102935
    Purity: 95%
    MF: C7H4BrNO
    MW: 198.019
    Storage: 2-8 degree Celsius
    SMILES: BrC1=CC=C2N=COC2=C1
  10. 5-methoxybenzo[d]oxazole-2-carboxylic acid

    CAS No.: 49559-68-4
    Catalog No.: 103020
    Purity: 95%
    MF: C9H7NO4
    MW: 193.158
    Storage: 2-8 degree Celsius
Loading ...Load More ...
Set Descending Direction

   

Items 1 to 10 of 291 total

  1. 1
  2. 2
  3. 3
  4. 4
  5. 5