•  
SSL
0item(s)

You have no items in your shopping cart.

Product was successfully added to your shopping cart.

Benzoxadiazoles

Set Descending Direction

   

Items 41 to 50 of 64 total

  1. 3
  2. 4
  3. 5
  4. 6
  5. 7
  1. 4-nitro-7-(piperazin-1-yl)benzo[c][1,2,5]oxadiazole

    CAS No.: 139332-66-4
    Catalog No.: TQP0982
    Purity: 95%
    MF: C10H11N5O3
    MW: 249.23
    Storage: 2-8 degree Celsius
    SMILES: [N+](=O)([O-])C1=CC=C(C2=NON=C21)N2CCNCC2
  2. N,N-dimethyl-7-nitrobenzo[c][1,2,5]oxadiazol-4-amine

    CAS No.: 1455-87-4
    Catalog No.: TQP0984
    Purity: 95%
    MF: C8H8N4O3
    MW: 208.177
    Storage: 2-8 degree Celsius
    SMILES: CN(C1=CC=C(C2=NON=C21)[N+](=O)[O-])C
  3. 7-nitro-N-phenylbenzo[c][1,2,5]oxadiazol-4-amine

    CAS No.: 18378-15-9
    Catalog No.: TQP0986
    Purity: 95%
    MF: C12H8N4O3
    MW: 256.221
    Storage: 2-8 degree Celsius
    SMILES: [N+](=O)([O-])C1=CC=C(C=2C1=NON2)NC2=CC=CC=C2
  4. N-methyl-7-nitrobenzo[c][1,2,5]oxadiazol-4-amine

    CAS No.: 18378-29-5
    Catalog No.: TQP0987
    Purity: 95%
    MF: C7H6N4O3
    MW: 194.15
    Storage: 2-8 degree Celsius
    SMILES: CNC1=CC=C(C2=NON=C21)[N+](=O)[O-]
  5. 7-nitro-N-octylbenzo[c][1,2,5]oxadiazol-4-amine

    CAS No.: 94102-48-4
    Catalog No.: TQP0988
    Purity: 95%
    MF: C14H20N4O3
    MW: 292.339
    Storage: 2-8 degree Celsius
    SMILES: [N+](=O)([O-])C1=CC=C(C=2C1=NON2)NCCCCCCCC
  6. 3-((7-nitrobenzo[c][1,2,5]oxadiazol-4-yl)amino)propanoic acid

    CAS No.: 149079-60-7
    Catalog No.: TQP0989
    Purity: 95%
    MF: C9H8N4O5
    MW: 252.186
    Storage: 2-8 degree Celsius
    SMILES: [N+](=O)([O-])C1=CC=C(C=2C1=NON2)NCCC(=O)O
  7. 7-nitro-N-(prop-2-yn-1-yl)benzo[c][1,2,5]oxadiazol-4-amine

    CAS No.: 1201012-14-7
    Catalog No.: TQP0990
    Purity: 95%
    MF: C9H6N4O3
    MW: 218.172
    Storage: 2-8 degree Celsius
    SMILES: [N+](=O)([O-])C1=CC=C(C=2C1=NON2)NCC#C
  8. 4-nitro-7-(piperidin-1-yl)benzo[c][1,2,5]oxadiazole

    CAS No.: 18378-22-8
    Catalog No.: TQP0991
    Purity: 95%
    MF: C11H12N4O3
    MW: 248.242
    Storage: 2-8 degree Celsius
    SMILES: [N+](=O)([O-])C1=CC=C(C2=NON=C21)N2CCCCC2
  9. N1-(7-nitrobenzo[c][1,2,5]oxadiazol-4-yl)ethane-1,2-diamine 2,2,2-trifluoroacetate

    CAS No.: 1818303-25-1
    Catalog No.: TQR1258
    Purity: 95%
    MF: C10H10F3N5O5
    MW: 337.214
    Storage: 2-8 degree Celsius
    SMILES: FC(C(=O)O)(F)F.[N+](=O)([O-])C1=CC=C(C=2C1=NON2)NCCN
  10. N-hexadecyl-7-nitrobenzo[c][1,2,5]oxadiazol-4-amine

    CAS No.: 101237-16-5
    Catalog No.: TQP0993
    Purity: 95%
    MF: C22H36N4O3
    MW: 404.555
    Storage: 2-8 degree Celsius
    SMILES: C(CCCCCCCCCCCCCCC)NC1=CC=C(C2=NON=C21)[N+](=O)[O-]
Loading ...Load More ...
Set Descending Direction

   

Items 41 to 50 of 64 total

  1. 3
  2. 4
  3. 5
  4. 6
  5. 7