•  
SSL
0item(s)

You have no items in your shopping cart.

Product was successfully added to your shopping cart.

Benzoxadiazoles

Set Ascending Direction

   

Items 11 to 20 of 64 total

  1. 1
  2. 2
  3. 3
  4. 4
  5. 5
  1. 4-nitro-7-phenoxybenzo[c][1,2,5]oxadiazole

    CAS No.: 16597-10-7
    Catalog No.: TQP1022
    Purity: 95%
    MF: C12H7N3O4
    MW: 257.205
    Storage: 2-8 degree Celsius
    SMILES: [N+](=O)([O-])C1=CC=C(C2=NON=C21)OC2=CC=CC=C2
  2. 4-ethoxy-7-nitrobenzo[c][1,2,5]oxadiazole

    CAS No.: 81432-10-2
    Catalog No.: TQP1023
    Purity: 95%
    MF: C8H7N3O4
    MW: 209.161
    Storage: 2-8 degree Celsius
    SMILES: C(C)OC1=CC=C(C2=NON=C21)[N+](=O)[O-]
  3. 2-((7-nitrobenzo[c][1,2,5]oxadiazol-4-yl)oxy)ethanol

    CAS No.: 66770-00-1
    Catalog No.: TQP1024
    Purity: 95%
    MF: C8H7N3O5
    MW: 225.16
    Storage: 2-8 degree Celsius
    SMILES: [N+](=O)([O-])C1=CC=C(C=2C1=NON2)OCCO
  4. 7-nitrobenzo[c][1,2,5]oxadiazole-4-carboxylic acid

    CAS No.: 32863-22-2
    Catalog No.: TQP1238
    Purity: 95%
    MF: C7H3N3O5
    MW: 209.117
    Storage: 2-8 degree Celsius
    SMILES: [N+](=O)([O-])C1=CC=C(C=2C1=NON2)C(=O)O
  5. 7-nitrobenzo[c][1,2,5]oxadiazole-4-carbaldehyde

    CAS No.: 1454663-36-5
    Catalog No.: TQP1239
    Purity: 95%
    MF: C7H3N3O4
    MW: 193.118
    Storage: 2-8 degree Celsius
    SMILES: [N+](=O)([O-])C1=CC=C(C=2C1=NON2)C=O
  6. 3-((7-nitrobenzo[c][1,2,5]oxadiazol-4-yl)thio)propanoic acid

    CAS No.: 77460-16-3
    Catalog No.: TQP2281
    Purity: 95%
    MF: C9H7N3O5S
    MW: 269.238
    Storage: 2-8 degree Celsius
    SMILES: [N+](=O)([O-])C1=CC=C(C=2C1=NON2)SCCC(=O)O
  7. N-?hexyl-?7-?nitro-?2,?1,?3-?benzoxadiazol-?4-?amine

    CAS No.: 94102-47-3
    Catalog No.: TQP1010
    Purity: 95%
    MF: C12H16N4O3
    MW: 264.285
    Storage: 2-8 degree Celsius
    SMILES: C(CCCCC)NC1=CC=C(C2=NON=C21)[N+](=O)[O-]
  8. 2-((7-nitrobenzo[c][1,2,5]oxadiazol-4-yl)thio)acetic acid

    CAS No.: 18333-81-8
    Catalog No.: TQP2283
    Purity: 95%
    MF: C8H5N3O5S
    MW: 255.211
    Storage: 2-8 degree Celsius
    SMILES: [N+](=O)([O-])C1=CC=C(C=2C1=NON2)SCC(=O)O
  9. 8-((7-nitrobenzo[c][1,2,5]oxadiazol-4-yl)thio)octan-1-ol

    CAS No.: 1233874-04-8
    Catalog No.: TQP2284
    Purity: 95%
    MF: C14H19N3O4S
    MW: 325.39
    Storage: 2-8 degree Celsius
    SMILES: [N+](=O)([O-])C1=CC=C(C=2C1=NON2)SCCCCCCCCO
  10. N1-(7-nitrobenzo[c][1,2,5]oxadiazol-4-yl)propane-1,3-diamine hydrochloride

    CAS No.: 1315553-40-2
    Catalog No.: TQP2970
    Purity: 95%
    MF: C9H12ClN5O3
    MW: 273.68
    Storage: 2-8 degree Celsius
    SMILES: Cl.[N+](=O)([O-])C1=CC=C(C=2C1=NON2)NCCCN
Loading ...Load More ...
Set Ascending Direction

   

Items 11 to 20 of 64 total

  1. 1
  2. 2
  3. 3
  4. 4
  5. 5