•  
SSL
0item(s)

You have no items in your shopping cart.

Product was successfully added to your shopping cart.

Benzotriazines

Set Ascending Direction

   

Items 11 to 20 of 53 total

  1. 1
  2. 2
  3. 3
  4. 4
  5. 5
  1. 3-chloro-6-methoxybenzo[e][1,2,4]triazine 1-oxide

    CAS No.: 736139-25-6
    Catalog No.: TQP2570
    Purity: 95%
    MF: C8H6ClN3O2
    MW: 211.608
    Storage: 2-8 degree Celsius
    SMILES: ClC=1N=[N+](C2=C(N1)C=C(C=C2)OC)[O-]
  2. 3,6-dichlorobenzo[e][1,2,4]triazine 1-oxide

    CAS No.: 70373-13-6
    Catalog No.: TQP2571
    Purity: 95%
    MF: C7H3Cl2N3O
    MW: 216.027
    Storage: 2-8 degree Celsius
    SMILES: ClC=1N=[N+](C2=C(N1)C=C(C=C2)Cl)[O-]
  3. 3-chloro-6-fluorobenzo[e][1,2,4]triazine 1-oxide

    CAS No.: 763132-13-4
    Catalog No.: TQP2572
    Purity: 95%
    MF: C7H3ClFN3O
    MW: 199.572
    Storage: 2-8 degree Celsius
    SMILES: ClC=1N=[N+](C2=C(N1)C=C(C=C2)F)[O-]
  4. 3-chloro-7-(trifluoromethyl)benzo[e][1,2,4]triazine 1-oxide

    CAS No.: 62843-74-7
    Catalog No.: TQP2573
    Purity: 95%
    MF: C8H3ClF3N3O
    MW: 249.579
    Storage: 2-8 degree Celsius
    SMILES: ClC=1N=[N+](C2=C(N1)C=CC(=C2)C(F)(F)F)[O-]
  5. 7-bromobenzo[e][1,2,4]triazin-3-amine

    CAS No.: 500889-65-6
    Catalog No.: TQP0610
    Purity: 95%
    MF: C7H5BrN4
    MW: 225.049
    Storage: 2-8 degree Celsius
    SMILES: BrC1=CC2=C(N=C(N=N2)N)C=C1
  6. 7-carboxy-3-chlorobenzo[e][1,2,4]triazine 1-oxide

    CAS No.: 7030-17-3
    Catalog No.: TQP2576
    Purity: 95%
    MF: C8H4ClN3O3
    MW: 225.591
    Storage: 2-8 degree Celsius
    SMILES: C(=O)(O)C1=CC2=C(N=C(N=[N+]2[O-])Cl)C=C1
  7. 3-chloro-6,7-dimethylbenzo[e][1,2,4]triazine 1-oxide

    CAS No.: 763131-96-0
    Catalog No.: TQP2578
    Purity: 95%
    MF: C9H8ClN3O
    MW: 209.636
    Storage: 2-8 degree Celsius
    SMILES: ClC=1N=[N+](C2=C(N1)C=C(C(=C2)C)C)[O-]
  8. 3-chloro-6-(trifluoromethyl)benzo[e][1,2,4]triazine 1-oxide

    CAS No.: 763132-23-6
    Catalog No.: TQP2579
    Purity: 95%
    MF: C8H3ClF3N3O
    MW: 249.579
    Storage: 2-8 degree Celsius
    SMILES: ClC=1N=[N+](C2=C(N1)C=C(C=C2)C(F)(F)F)[O-]
  9. 3-chloro-6-isopropylbenzo[e][1,2,4]triazine 1-oxide

    CAS No.: 763132-25-8
    Catalog No.: TQP2580
    Purity: 95%
    MF: C10H10ClN3O
    MW: 223.663
    Storage: 2-8 degree Celsius
    SMILES: ClC=1N=[N+](C2=C(N1)C=C(C=C2)C(C)C)[O-]
  10. 6-(tert-butyl)-3-chlorobenzo[e][1,2,4]triazine 1-oxide

    CAS No.: 763132-32-7
    Catalog No.: TQP2581
    Purity: 95%
    MF: C11H12ClN3O
    MW: 237.69
    Storage: 2-8 degree Celsius
    SMILES: C(C)(C)(C)C=1C=CC2=C(N=C(N=[N+]2[O-])Cl)C1
Loading ...Load More ...
Set Ascending Direction

   

Items 11 to 20 of 53 total

  1. 1
  2. 2
  3. 3
  4. 4
  5. 5