•  
SSL
0item(s)

You have no items in your shopping cart.

Product was successfully added to your shopping cart.

Benzotriazines

Set Descending Direction

   

Items 1 to 10 of 58 total

  1. 1
  2. 2
  3. 3
  4. 4
  5. 5
  1. 3,6-dichlorobenzo[e][1,2,4]triazine 1-oxide

    CAS No.: 70373-13-6
    Catalog No.: TQP2571
    Purity: 95%
    MF: C7H3Cl2N3O
    MW: 216.027
    Storage: 2-8 degree Celsius
    SMILES: ClC=1N=[N+](C2=C(N1)C=C(C=C2)Cl)[O-]
  2. 7-methoxybenzo[e][1,2,4]triazin-3-amine

    CAS No.: 27238-40-0
    Catalog No.: TQP0607
    Purity: 95%
    MF: C8H8N4O
    MW: 176.179
    Storage: 2-8 degree Celsius
    SMILES: COC1=CC2=C(N=C(N=N2)N)C=C1
  3. 7-bromo-5-methylbenzo[e][1,2,4]triazin-3-amine

    CAS No.: 867330-26-5
    Catalog No.: TQP0608
    Purity: 95%
    MF: C8H7BrN4
    MW: 239.076
    Storage: 2-8 degree Celsius
    SMILES: BrC1=CC2=C(N=C(N=N2)N)C(=C1)C
  4. 3-amino-7-chlorobenzo[e][1,2,4]triazine 1-oxide

    CAS No.: 18671-92-6
    Catalog No.: TQP0609
    Purity: 95%
    MF: C7H5ClN4O
    MW: 196.597
    Storage: 2-8 degree Celsius
    SMILES: NC=1N=[N+](C2=C(N1)C=CC(=C2)Cl)[O-]
  5. 7-bromobenzo[e][1,2,4]triazin-3-amine

    CAS No.: 500889-65-6
    Catalog No.: TQP0610
    Purity: 95%
    MF: C7H5BrN4
    MW: 225.049
    Storage: 2-8 degree Celsius
    SMILES: BrC1=CC2=C(N=C(N=N2)N)C=C1
  6. 3-amino-7-methoxybenzo[e][1,2,4]triazine 1-oxide

    CAS No.: 27238-35-3
    Catalog No.: TQP0611
    Purity: 95%
    MF: C8H8N4O2
    MW: 192.178
    Storage: 2-8 degree Celsius
    SMILES: NC=1N=[N+](C2=C(N1)C=CC(=C2)OC)[O-]
  7. 3-amino-7-nitrobenzo[e][1,2,4]triazine 1-oxide

    CAS No.: 1016-90-6
    Catalog No.: TQP0612
    Purity: 95%
    MF: C7H5N5O3
    MW: 207.149
    Storage: 2-8 degree Celsius
    SMILES: NC=1N=[N+](C2=C(N1)C=CC(=C2)[N+](=O)[O-])[O-]
  8. 7-bromo-3-oxo-3,4-dihydrobenzo[e][1,2,4]triazine 1-oxide

    CAS No.: 70373-30-7
    Catalog No.: TQP2562
    Purity: 95%
    MF: C7H4BrN3O2
    MW: 242.032
    Storage: 2-8 degree Celsius
    SMILES: BrC1=CC2=C(NC(N=[N+]2[O-])=O)C=C1
  9. 3-chlorobenzo[e][1,2,4]triazine 1-oxide

    CAS No.: 67692-91-5
    Catalog No.: TQP2563
    Purity: 95%
    MF: C7H4ClN3O
    MW: 181.582
    Storage: 2-8 degree Celsius
    SMILES: ClC=1N=[N+](C2=C(N1)C=CC=C2)[O-]
  10. 3,7-dichlorobenzo[e][1,2,4]triazine 1-oxide

    CAS No.: 18671-94-8
    Catalog No.: TQP2564
    Purity: 95%
    MF: C7H3Cl2N3O
    MW: 216.027
    Storage: 2-8 degree Celsius
    SMILES: ClC=1N=[N+](C2=C(N1)C=CC(=C2)Cl)[O-]
Loading ...Load More ...
Set Descending Direction

   

Items 1 to 10 of 58 total

  1. 1
  2. 2
  3. 3
  4. 4
  5. 5