•  
SSL
0item(s)

You have no items in your shopping cart.

Product was successfully added to your shopping cart.

Benzothiazines

Set Ascending Direction

   

Items 21 to 27 of 27 total

  1. 1
  2. 2
  3. 3
  1. 7-methyl-2H-benzo[e][1,2,4]thiadiazin-3(4H)-one 1,1-dioxide

    CAS No.: 71254-63-2
    Catalog No.: TQR1426
    Purity: 95%
    MF: C8H8N2O3S
    MW: 212.23
    Storage: 2-8 degree Celsius
    SMILES: CC1=CC2=C(NC(NS2(=O)=O)=O)C=C1
  2. 7-methoxy-2H-benzo[e][1,2,4]thiadiazin-3(4H)-one 1,1-dioxide

    CAS No.: 71254-67-6
    Catalog No.: TQR1425
    Purity: 95%
    MF: C8H8N2O4S
    MW: 228.229
    Storage: 2-8 degree Celsius
    SMILES: COC1=CC2=C(NC(NS2(=O)=O)=O)C=C1
  3. 4-Methyl-3,4-dihydro-2H-1lambda6,2,4-benzothiadiazine-1,1,3-trione

    CAS No.: 13338-02-8
    Catalog No.: TQR1424
    Purity: 95%
    MF: C8H8N2O3S
    MW: 212.23
    Storage: 2-8 degree Celsius
    SMILES: CN1C(NS(C2=C1C=CC=C2)(=O)=O)=O
  4. 2H-benzo[e][1,2,4]thiadiazin-3(4H)-one 1,1-dioxide

    CAS No.: 13338-00-6
    Catalog No.: TQR1423
    Purity: 95%
    MF: C7H6N2O3S
    MW: 198.203
    Storage: 2-8 degree Celsius
    SMILES: S1(NC(NC2=C1C=CC=C2)=O)(=O)=O
  5. 7-fluoro-2H-benzo[e][1,2,4]thiadiazin-3(4H)-one 1,1-dioxide

    CAS No.: 152721-97-6
    Catalog No.: TQR1422
    Purity: 95%
    MF: C7H5FN2O3S
    MW: 216.193
    Storage: 2-8 degree Celsius
    SMILES: FC1=CC2=C(NC(NS2(=O)=O)=O)C=C1
  6. 7-methoxy-4H-benzo[e][1,2,4]thiadiazine 1,1-dioxide

    CAS No.: 549495-12-7
    Catalog No.: TQR1072
    Purity: 95%
    MF: C8H8N2O3S
    MW: 212.23
    Storage: 2-8 degree Celsius
    SMILES: COC1=CC2=C(NC=NS2(=O)=O)C=C1
  7. 4-methyl-6-vinyl-3,4-dihydro-2H-benzo[e][1,2,4]thiadiazine 1,1-dioxide

    CAS No.: 2231081-73-3
    Catalog No.: TQR0612
    Purity: 95%
    MF: C10H12N2O2S
    MW: 224.285
    Storage: 2-8 degree Celsius
    SMILES: CN1CNS(C2=C1C=C(C=C2)C=C)(=O)=O
Loading ...Load More ...
Set Ascending Direction

   

Items 21 to 27 of 27 total

  1. 1
  2. 2
  3. 3