•  
SSL
0item(s)

You have no items in your shopping cart.

Product was successfully added to your shopping cart.

Benzothiazines

Set Descending Direction

   

Items 11 to 20 of 27 total

  1. 1
  2. 2
  3. 3
  1. 6-methoxy-3,4-dihydro-1H-benzo[d][1,2]thiazine 2,2-dioxide

    CAS No.: 1169882-37-4
    Catalog No.: TQP2054
    Purity: 95%
    MF: C9H11NO3S
    MW: 213.258
    Storage: 2-8 degree Celsius
    SMILES: COC=1C=CC2=C(CNS(C2)(=O)=O)C1
  2. 6-fluoro-3,4-dihydro-1H-benzo[d][1,2]thiazine 2,2-dioxide

    CAS No.: 1401912-25-1
    Catalog No.: TQP2053
    Purity: 95%
    MF: C8H8FNO2S
    MW: 201.222
    Storage: 2-8 degree Celsius
    SMILES: FC=1C=CC2=C(CNS(C2)(=O)=O)C1
  3. 6-bromo-3,4-dihydro-1H-benzo[d][1,2]thiazine 2,2-dioxide

    CAS No.: 115540-65-3
    Catalog No.: TQP2052
    Purity: 95%
    MF: C8H8BrNO2S
    MW: 262.128
    Storage: 2-8 degree Celsius
    SMILES: BrC=1C=CC2=C(CNS(C2)(=O)=O)C1
  4. 6-chloro-3,4-dihydro-1H-benzo[d][1,2]thiazine 2,2-dioxide

    CAS No.: 110654-53-0
    Catalog No.: TQP2051
    Purity: 95%
    MF: C8H8ClNO2S
    MW: 217.677
    Storage: 2-8 degree Celsius
    SMILES: ClC=1C=CC2=C(CNS(C2)(=O)=O)C1
  5. 4-cyclopropyl-7-(3-methoxyphenoxy)-3,4-dihydro-2H-benzo[e][1,2,4]thiadiazine 1,1-dioxide

    CAS No.: 1314805-66-7
    Catalog No.: TQR0611
    Purity: 95%
    MF: C17H18N2O4S
    MW: 346.408
    Storage: 2-8 degree Celsius
    SMILES: C1(CC1)N1CNS(C2=C1C=CC(=C2)OC2=CC(=CC=C2)OC)(=O)=O
  6. 7-methyl-3,4-dihydro-1H-benzo[d][1,2]thiazine 2,2-dioxide

    CAS No.: 110654-47-2
    Catalog No.: TQP2049
    Purity: 95%
    MF: C9H11NO2S
    MW: 197.259
    Storage: 2-8 degree Celsius
    SMILES: CC1=CC2=C(CNS(C2)(=O)=O)C=C1
  7. 3,4-dihydro-2H-benzo[b][1,4]thiazine 1,1-dioxide

    CAS No.: 82299-64-7
    Catalog No.: WLZ3478
    Purity: 95%
    MF: C8H9NO2S
    MW: 183.232
    Storage: 2-8 degree Celsius
    SMILES: S1(C2=C(NCC1)C=CC=C2)(=O)=O
  8. 3-oxo-3,4-dihydro-2H-benzo[e][1,2,4]thiadiazine-7-carboxylic acid 1,1-dioxide

    CAS No.: 201224-76-2
    Catalog No.: TQR1429
    Purity: 95%
    MF: C8H6N2O5S
    MW: 242.212
    Storage: 2-8 degree Celsius
    SMILES: O=C1NS(C2=C(N1)C=CC(=C2)C(=O)O)(=O)=O
  9. 4-ethyl-2H-benzo[e][1,2,4]thiadiazin-3(4H)-one 1,1-dioxide

    CAS No.: 102308-74-7
    Catalog No.: TQR1428
    Purity: 95%
    MF: C9H10N2O3S
    MW: 226.257
    Storage: 2-8 degree Celsius
    SMILES: C(C)N1C(NS(C2=C1C=CC=C2)(=O)=O)=O
  10. 7-bromo-2H-benzo[e][1,2,4]thiadiazin-3(4H)-one 1,1-dioxide

    CAS No.: 14141-71-0
    Catalog No.: TQR1427
    Purity: 95%
    MF: C7H5BrN2O3S
    MW: 277.099
    Storage: 2-8 degree Celsius
    SMILES: BrC1=CC2=C(NC(NS2(=O)=O)=O)C=C1
Loading ...Load More ...
Set Descending Direction

   

Items 11 to 20 of 27 total

  1. 1
  2. 2
  3. 3