•  
SSL
0item(s)

You have no items in your shopping cart.

Product was successfully added to your shopping cart.

Benzothiazines

Set Descending Direction

   

Items 1 to 10 of 35 total

  1. 1
  2. 2
  3. 3
  4. 4
  1. 4-Methyl-3,4-dihydro-2H-1lambda6,2,4-benzothiadiazine-1,1,3-trione

    CAS No.: 13338-02-8
    Catalog No.: TQR1424
    Purity: 95%
    MF: C8H8N2O3S
    MW: 212.23
    Storage: 2-8 degree Celsius
    SMILES: CN1C(NS(C2=C1C=CC=C2)(=O)=O)=O
  2. 6-amino-3,4-dihydro-1H-benzo[d][1,2]thiazine 2,2-dioxide

    CAS No.: 1704494-33-6
    Catalog No.: TQP2055
    Purity: 95%
    MF: C8H10N2O2S
    MW: 198.247
    Storage: 2-8 degree Celsius
    SMILES: NC=1C=CC2=C(CNS(C2)(=O)=O)C1
  3. 6-nitro-3,4-dihydro-1H-benzo[d][1,2]thiazine 2,2-dioxide

    CAS No.: 110654-59-6
    Catalog No.: TQP2056
    Purity: 95%
    MF: C8H8N2O4S
    MW: 228.229
    Storage: 2-8 degree Celsius
    SMILES: [N+](=O)([O-])C=1C=CC2=C(CNS(C2)(=O)=O)C1
  4. 8-chloro-3,4-dihydro-1H-benzo[d][1,2]thiazine 2,2-dioxide

    CAS No.: 110654-50-7
    Catalog No.: TQP2057
    Purity: 95%
    MF: C8H8ClNO2S
    MW: 217.677
    Storage: 2-8 degree Celsius
    SMILES: ClC1=CC=CC=2CNS(CC21)(=O)=O
  5. 4-cyclopropyl-7-(3-methoxyphenoxy)-3,4-dihydro-2H-benzo[e][1,2,4]thiadiazine 1,1-dioxide

    CAS No.: 1314805-66-7
    Catalog No.: TQR0611
    Purity: 95%
    MF: C17H18N2O4S
    MW: 346.408
    Storage: 2-8 degree Celsius
    SMILES: C1(CC1)N1CNS(C2=C1C=CC(=C2)OC2=CC(=CC=C2)OC)(=O)=O
  6. 4-methyl-6-vinyl-3,4-dihydro-2H-benzo[e][1,2,4]thiadiazine 1,1-dioxide

    CAS No.: 2231081-73-3
    Catalog No.: TQR0612
    Purity: 95%
    MF: C10H12N2O2S
    MW: 224.285
    Storage: 2-8 degree Celsius
    SMILES: CN1CNS(C2=C1C=C(C=C2)C=C)(=O)=O
  7. 7-methoxy-4H-benzo[e][1,2,4]thiadiazine 1,1-dioxide

    CAS No.: 549495-12-7
    Catalog No.: TQR1072
    Purity: 95%
    MF: C8H8N2O3S
    MW: 212.23
    Storage: 2-8 degree Celsius
    SMILES: COC1=CC2=C(NC=NS2(=O)=O)C=C1
  8. 7-fluoro-2H-benzo[e][1,2,4]thiadiazin-3(4H)-one 1,1-dioxide

    CAS No.: 152721-97-6
    Catalog No.: TQR1422
    Purity: 95%
    MF: C7H5FN2O3S
    MW: 216.193
    Storage: 2-8 degree Celsius
    SMILES: FC1=CC2=C(NC(NS2(=O)=O)=O)C=C1
  9. 2H-benzo[e][1,2,4]thiadiazin-3(4H)-one 1,1-dioxide

    CAS No.: 13338-00-6
    Catalog No.: TQR1423
    Purity: 95%
    MF: C7H6N2O3S
    MW: 198.203
    Storage: 2-8 degree Celsius
    SMILES: S1(NC(NC2=C1C=CC=C2)=O)(=O)=O
  10. 6-methoxy-3,4-dihydro-1H-benzo[d][1,2]thiazine 2,2-dioxide

    CAS No.: 1169882-37-4
    Catalog No.: TQP2054
    Purity: 95%
    MF: C9H11NO3S
    MW: 213.258
    Storage: 2-8 degree Celsius
    SMILES: COC=1C=CC2=C(CNS(C2)(=O)=O)C1
Loading ...Load More ...
Set Descending Direction

   

Items 1 to 10 of 35 total

  1. 1
  2. 2
  3. 3
  4. 4