•  
SSL
0item(s)

You have no items in your shopping cart.

Product was successfully added to your shopping cart.

Benzothiazines

Set Ascending Direction

   

Items 11 to 20 of 35 total

  1. 1
  2. 2
  3. 3
  4. 4
  1. 7-methoxy-2H-benzo[e][1,2,4]thiadiazin-3(4H)-one 1,1-dioxide

    CAS No.: 71254-67-6
    Catalog No.: TQR1425
    Purity: 95%
    MF: C8H8N2O4S
    MW: 228.229
    Storage: 2-8 degree Celsius
    SMILES: COC1=CC2=C(NC(NS2(=O)=O)=O)C=C1
  2. 7-methyl-2H-benzo[e][1,2,4]thiadiazin-3(4H)-one 1,1-dioxide

    CAS No.: 71254-63-2
    Catalog No.: TQR1426
    Purity: 95%
    MF: C8H8N2O3S
    MW: 212.23
    Storage: 2-8 degree Celsius
    SMILES: CC1=CC2=C(NC(NS2(=O)=O)=O)C=C1
  3. 7-bromo-2H-benzo[e][1,2,4]thiadiazin-3(4H)-one 1,1-dioxide

    CAS No.: 14141-71-0
    Catalog No.: TQR1427
    Purity: 95%
    MF: C7H5BrN2O3S
    MW: 277.099
    Storage: 2-8 degree Celsius
    SMILES: BrC1=CC2=C(NC(NS2(=O)=O)=O)C=C1
  4. 4-ethyl-2H-benzo[e][1,2,4]thiadiazin-3(4H)-one 1,1-dioxide

    CAS No.: 102308-74-7
    Catalog No.: TQR1428
    Purity: 95%
    MF: C9H10N2O3S
    MW: 226.257
    Storage: 2-8 degree Celsius
    SMILES: C(C)N1C(NS(C2=C1C=CC=C2)(=O)=O)=O
  5. 3-oxo-3,4-dihydro-2H-benzo[e][1,2,4]thiadiazine-7-carboxylic acid 1,1-dioxide

    CAS No.: 201224-76-2
    Catalog No.: TQR1429
    Purity: 95%
    MF: C8H6N2O5S
    MW: 242.212
    Storage: 2-8 degree Celsius
    SMILES: O=C1NS(C2=C(N1)C=CC(=C2)C(=O)O)(=O)=O
  6. 7-methoxy-3,4-dihydro-2H-benzo[b][1,4]thiazine

    CAS No.: 151328-18-6
    Catalog No.: WLZ1872
    Purity: 95%
    MF: C9H11NOS
    MW: 181.26
    Storage: 2-8 degree Celsius
    SMILES: COC=1C=CC2=C(SCCN2)C1
  7. 4-(2-fluorobenzyl)-2H-benzo[b][1,4]thiazin-3(4H)-one

    CAS No.: 17493-28-6
    Catalog No.: 197646
    Purity: 95%
    MF: C15H12FNOS
    MW: 273.332
    Storage: 2-8 degree Celsius
    SMILES: FC1=C(CN2C3=C(SCC2=O)C=CC=C3)C=CC=C1
  8. 3,4-dihydro-2H-benzo[b][1,4]thiazine 1,1-dioxide

    CAS No.: 82299-64-7
    Catalog No.: WLZ3478
    Purity: 95%
    MF: C8H9NO2S
    MW: 183.232
    Storage: 2-8 degree Celsius
    SMILES: S1(C2=C(NCC1)C=CC=C2)(=O)=O
  9. 6-chloro-2H-benzo[e][1,2,4]thiadiazin-3(4H)-one 1,1-dioxide

    CAS No.: 1672-20-4
    Catalog No.: 135786
    Purity: 95%
    MF: C7H5ClN2O3S
    MW: 232.648
    Storage: 2-8 degree Celsius
  10. 6-(hydroxymethyl)-2h-benzo[b][1,4]thiazin-3(4h)-one

    CAS No.: 443955-31-5
    Catalog No.: 102113
    Purity: 95%
    MF: C9H9NO2S
    MW: 195.243
    Storage: 2-8 degree Celsius
    SMILES: OCC1=CC=C2SCC(=O)NC2=C1
Loading ...Load More ...
Set Ascending Direction

   

Items 11 to 20 of 35 total

  1. 1
  2. 2
  3. 3
  4. 4