•  
SSL
0item(s)

You have no items in your shopping cart.

Product was successfully added to your shopping cart.

Benzothiazepines

Set Ascending Direction

   

Items 31 to 37 of 37 total

  1. 1
  2. 2
  3. 3
  4. 4
  1. 8-bromo-4-methyl-2,3,4,5-tetrahydrobenzo[f][1,2]thiazepine 1,1-dioxide

    CAS No.: 1799979-21-7
    Catalog No.: 133104
    Purity: 95%
    MF: C10H12BrNO2S
    MW: 290.182
    Storage: 2-8 degree Celsius
  2. 4-methyl-8-(trifluoromethyl)-2,3,4,5-tetrahydrobenzo[f][1,2]thiazepine 1,1-dioxide

    CAS No.: 1301768-19-3
    Catalog No.: 133106
    Purity: 95%
    MF: C11H12F3NO2S
    MW: 279.283
    Storage: 2-8 degree Celsius
  3. (S)-tert-butyl (4-oxo-2,3,4,5-tetrahydrobenzo[b][1,4]thiazepin-3-yl)carbamate

    CAS No.: 440634-11-7
    Catalog No.: 133663
    Purity: 95%
    MF: C14H18N2O3S
    MW: 294.376
    Storage: 2-8 degree Celsius
  4. 3-chloro-11-hydroxy-6-methyl-6,11-dihydrodibenzo[c,f][1,2]thiazepine 5,5-dioxide

    CAS No.: 26723-60-4
    Catalog No.: 145770
    Purity: 95%
    MF: C14H12ClNO3S
    MW: 309.774
    Storage: 2-8 degree Celsius
    SMILES: CN1C2=C(C=CC=C2)C(O)C2=C(C=C(Cl)C=C2)S1(=O)=O
  5. 3-chloro-6-methyldibenzo[c,f][1,2]thiazepin-11(6H)-one 5,5-dioxide

    CAS No.: 26638-53-9
    Catalog No.: 145777
    Purity: 95%
    MF: C14H10ClNO3S
    MW: 307.758
    Storage: 2-8 degree Celsius
    SMILES: CN1C2=C(C=CC=C2)C(=O)C2=C(C=C(Cl)C=C2)S1(=O)=O
  6. 3,11-dichloro-6,11-dihydro-6-methyldibenzo[c,f][1,2]thiazepine 5,5-dioxide

    CAS No.: 26638-66-4
    Catalog No.: 140256
    Purity: 95%
    MF: C14H11Cl2NO2S
    MW: 328.22
    Storage: 2-8 degree Celsius
    SMILES: CN1C2=C(C=CC=C2)C(Cl)C2=C(C=C(Cl)C=C2)S1(=O)=O
  7. 11-(piperazin-1-yl)dibenzo[b,f][1,4]thiazepine dihydrochloride

    CAS No.: 111974-74-4
    Catalog No.: 166216
    Purity: 95%
    MF: C17H19Cl2N3S
    MW: 368.333
    Storage: 2-8 degree Celsius
    SMILES: Cl.Cl.C1CN(CCN1)C1=NC2=CC=CC=C2SC2=CC=CC=C12
Loading ...Load More ...
Set Ascending Direction

   

Items 31 to 37 of 37 total

  1. 1
  2. 2
  3. 3
  4. 4