•  
SSL
0item(s)

You have no items in your shopping cart.

Product was successfully added to your shopping cart.

Benzopyrans

Set Descending Direction

   

Items 1 to 10 of 162 total

  1. 1
  2. 2
  3. 3
  4. 4
  5. 5
  1. (chroman-2-yl)methanamine

    CAS No.: 3990-59-8
    Catalog No.: 103466
    Purity: 95%
    MF: C10H13NO
    MW: 163.22
    Storage: 2-8 degree Celsius
    SMILES: NCC1CCC2=C(O1)C=CC=C2
  2. 2H-1-benzopyran-3-carboxylic acid

    CAS No.: 22649-28-1
    Catalog No.: 106581
    Purity: 95%
    MF: C10H8O3
    MW: 176.171
    Storage: 2-8 degree Celsius
  3. 6-methoxychroman-3-carboxylic acid

    CAS No.: 182570-26-9
    Catalog No.: 106582
    Purity: 95%
    MF: C11H12O4
    MW: 208.213
    Storage: 2-8 degree Celsius
  4. (S)-3,4-dihydro-2H-chromen-4-amine hydrochloride

    CAS No.: 1035093-81-2
    Catalog No.: 110112
    Purity: 95%
    MF: C9H12ClNO
    MW: 185.654
    Storage: 2-8 degree Celsius
  5. (R)-3,4-dihydro-2H-chromen-4-amine hydrochloride

    CAS No.: 730980-59-3
    Catalog No.: 110113
    Purity: 95%
    MF: C9H12ClNO
    MW: 185.654
    Storage: 2-8 degree Celsius
    SMILES: Cl[H].N[C@@H]1CCOC2=C1C=CC=C2
  6. 3,4-dihydro-2H-chromen-4-amine

    CAS No.: 53981-38-7
    Catalog No.: 110114
    Purity: 95%
    MF: C9H11NO
    MW: 149.193
    Storage: 2-8 degree Celsius
  7. (R)-chroman-3-amine hydrochloride

    CAS No.: 59108-53-1
    Catalog No.: 110190
    Purity: 95%
    MF: C9H12ClNO
    MW: 185.654
    Storage: 2-8 degree Celsius
  8. (S)-chroman-3-amine hydrochloride

    CAS No.: 59108-54-2
    Catalog No.: 110191
    Purity: 95%
    MF: C9H12ClNO
    MW: 185.654
    Storage: 2-8 degree Celsius
  9. chroman-4-amine hydrochloride

    CAS No.: 90609-63-5
    Catalog No.: 111255
    Purity: 95%
    MF: C9H12ClNO
    MW: 185.654
    Storage: 2-8 degree Celsius
  10. 8-tert-butylchroman-4-amine

    CAS No.: 890839-83-5
    Catalog No.: 111257
    Purity: 95%
    MF: C13H19NO
    MW: 205.301
    Storage: 2-8 degree Celsius
Loading ...Load More ...
Set Descending Direction

   

Items 1 to 10 of 162 total

  1. 1
  2. 2
  3. 3
  4. 4
  5. 5