•  
SSL
0item(s)

You have no items in your shopping cart.

Product was successfully added to your shopping cart.

Benzopteridines

Set Ascending Direction

   

Items 21 to 26 of 26 total

  1. 1
  2. 2
  3. 3
  1. 7-chlorobenzo[g]pteridine-2,4(1H,3H)-dione

    CAS No.: 3273-42-5
    Catalog No.: TQP1485
    Purity: 95%
    MF: C10H5ClN4O2
    MW: 248.629
    Storage: 2-8 degree Celsius
    SMILES: ClC=1C=CC2=C(N=C3C(NC(NC3=N2)=O)=O)C1
  2. 8-chlorobenzo[g]pteridine-2,4(1H,3H)-dione

    CAS No.: 2047-60-1
    Catalog No.: TQP1483
    Purity: 95%
    MF: C10H5ClN4O2
    MW: 248.629
    Storage: 2-8 degree Celsius
    SMILES: ClC1=CC2=C(N=C3C(NC(NC3=N2)=O)=O)C=C1
  3. 6-methylbenzo[g]pteridine-2,4(1H,3H)-dione

    CAS No.: 6431-46-5
    Catalog No.: TQP1482
    Purity: 95%
    MF: C11H8N4O2
    MW: 228.211
    Storage: 2-8 degree Celsius
    SMILES: CC1=CC=CC2=C1N=C1C(NC(NC1=N2)=O)=O
  4. 8-methylbenzo[g]pteridine-2,4(1H,3H)-dione

    CAS No.: 22525-69-5
    Catalog No.: TQP1481
    Purity: 95%
    MF: C11H8N4O2
    MW: 228.211
    Storage: 2-8 degree Celsius
    SMILES: CC1=CC2=C(N=C3C(NC(NC3=N2)=O)=O)C=C1
  5. 9-methylbenzo[g]pteridine-2,4(1H,3H)-dione

    CAS No.: 13351-37-6
    Catalog No.: TQP1480
    Purity: 95%
    MF: C11H8N4O2
    MW: 228.211
    Storage: 2-8 degree Celsius
    SMILES: CC1=CC=CC=2N=C3C(NC(NC3=NC21)=O)=O
  6. 7-methylbenzo[g]pteridine-2,4(1H,3H)-dione

    CAS No.: 15436-36-9
    Catalog No.: TQP1479
    Purity: 95%
    MF: C11H8N4O2
    MW: 228.211
    Storage: 2-8 degree Celsius
    SMILES: CC=1C=CC2=C(N=C3C(NC(NC3=N2)=O)=O)C1
Loading ...Load More ...
Set Ascending Direction

   

Items 21 to 26 of 26 total

  1. 1
  2. 2
  3. 3