•  
SSL
0item(s)

You have no items in your shopping cart.

Product was successfully added to your shopping cart.

Benzopteridines

Set Descending Direction

   

Items 11 to 20 of 26 total

  1. 1
  2. 2
  3. 3
  1. 1,3,7-trimethylbenzo[g]pteridine-2,4(1H,3H)-dione

    CAS No.: 2962-87-0
    Catalog No.: TQP1694
    Purity: 95%
    MF: C13H12N4O2
    MW: 256.265
    Storage: 2-8 degree Celsius
    SMILES: CN1C(N(C(C2=NC3=C(N=C12)C=CC(=C3)C)=O)C)=O
  2. 3-methylbenzo[g]pteridine-2,4(1H,3H)-dione

    CAS No.: 2891-59-0
    Catalog No.: TQP1693
    Purity: 95%
    MF: C11H8N4O2
    MW: 228.211
    Storage: 2-8 degree Celsius
    SMILES: CN1C(NC2=NC3=C(N=C2C1=O)C=CC=C3)=O
  3. 1,7,8-trimethylbenzo[g]pteridine-2,4(1H,3H)-dione

    CAS No.: 18950-64-6
    Catalog No.: TQP1692
    Purity: 95%
    MF: C13H12N4O2
    MW: 256.265
    Storage: 2-8 degree Celsius
    SMILES: CN1C(NC(C2=NC3=C(N=C12)C=C(C(=C3)C)C)=O)=O
  4. naphtho[2,3-g]pteridine-2,4(1H,3H)-dione

    CAS No.: 4794-65-4
    Catalog No.: TQP1478
    Purity: 95%
    MF: C14H8N4O2
    MW: 264.244
    Storage: 2-8 degree Celsius
    SMILES: N1C(NC(C2=NC3=C(N=C12)C=C1C=CC=CC1=C3)=O)=O
  5. 1,3,7,8-tetramethylbenzo[g]pteridine-2,4(1H,3H)-dione

    CAS No.: 14684-48-1
    Catalog No.: TQP1690
    Purity: 95%
    MF: C14H14N4O2
    MW: 270.292
    Storage: 2-8 degree Celsius
    SMILES: CN1C(N(C(C2=NC3=C(N=C12)C=C(C(=C3)C)C)=O)C)=O
  6. 1,3-dimethylbenzo[g]pteridine-2,4(1H,3H)-dione

    CAS No.: 2962-90-5
    Catalog No.: TQP1689
    Purity: 95%
    MF: C12H10N4O2
    MW: 242.238
    Storage: 2-8 degree Celsius
    SMILES: CN1C(N(C(C2=NC3=C(N=C12)C=CC=C3)=O)C)=O
  7. benzo[g]pteridine-2,4(1H,3H)-dione

    CAS No.: 490-59-5
    Catalog No.: TQP1688
    Purity: 95%
    MF: C10H6N4O2
    MW: 214.184
    Storage: 2-8 degree Celsius
    SMILES: N1C(NC(C2=NC3=C(N=C12)C=CC=C3)=O)=O
  8. 7,8-dichlorobenzo[g]pteridine-2,4(1H,3H)-dione

    CAS No.: 58590-56-0
    Catalog No.: TQP1488
    Purity: 95%
    MF: C10H4Cl2N4O2
    MW: 283.074
    Storage: 2-8 degree Celsius
    SMILES: ClC=1C(=CC2=C(N=C3C(NC(NC3=N2)=O)=O)C1)Cl
  9. 8-(dimethylamino)benzo[g]pteridine-2,4(1H,3H)-dione

    CAS No.: 17376-76-0
    Catalog No.: TQP1487
    Purity: 95%
    MF: C12H11N5O2
    MW: 257.253
    Storage: 2-8 degree Celsius
    SMILES: CN(C1=CC2=C(N=C3C(NC(NC3=N2)=O)=O)C=C1)C
  10. 6,7-dimethylbenzo[g]pteridine-2,4(1H,3H)-dione

    CAS No.: 16896-27-8
    Catalog No.: TQP1486
    Purity: 95%
    MF: C12H10N4O2
    MW: 242.238
    Storage: 2-8 degree Celsius
    SMILES: CC1=C(C=CC2=C1N=C1C(NC(NC1=N2)=O)=O)C
Loading ...Load More ...
Set Descending Direction

   

Items 11 to 20 of 26 total

  1. 1
  2. 2
  3. 3