•  
SSL
0item(s)

You have no items in your shopping cart.

Product was successfully added to your shopping cart.

Benzopteridines

Set Descending Direction

   

Items 1 to 10 of 27 total

  1. 1
  2. 2
  3. 3
  1. 1,3-dimethylbenzo[g]pteridine-2,4(1H,3H)-dione

    CAS No.: 2962-90-5
    Catalog No.: TQP1689
    Purity: 95%
    MF: C12H10N4O2
    MW: 242.238
    Storage: 2-8 degree Celsius
    SMILES: CN1C(N(C(C2=NC3=C(N=C12)C=CC=C3)=O)C)=O
  2. ethyl 2-(5,6-dimethyl-4-oxofuro[2,3-d]pyrimidin-3(4H)-yl)acetate

    CAS No.: 1189670-48-1
    Catalog No.: 195451
    Purity: 95%
    MF: C12H14N2O4
    MW: 250.2540
    Storage: 2-8 degree Celsius
    SMILES: CC1=C(OC=2N=CN(C(C21)=O)CC(=O)OCC)C
  3. 6,9-diphenylbenzo[g]pteridine-2,4(1H,3H)-dione

    CAS No.: 1194684-55-3
    Catalog No.: TQP1701
    Purity: 95%
    MF: C22H14N4O2
    MW: 366.38
    Storage: 2-8 degree Celsius
    SMILES: C1(=CC=CC=C1)C1=CC=C(C2=C1N=C1C(NC(NC1=N2)=O)=O)C2=CC=CC=C2
  4. 6,9-dimethylbenzo[g]pteridine-2,4(1H,3H)-dione

    CAS No.: 1006381-30-1
    Catalog No.: TQP1700
    Purity: 95%
    MF: C12H10N4O2
    MW: 242.238
    Storage: 2-8 degree Celsius
    SMILES: CC1=CC=C(C2=C1N=C1C(NC(NC1=N2)=O)=O)C
  5. 7,8-dimethoxybenzo[g]pteridine-2,4(1H,3H)-dione

    CAS No.: 855942-97-1
    Catalog No.: TQP1699
    Purity: 95%
    MF: C12H10N4O4
    MW: 274.236
    Storage: 2-8 degree Celsius
    SMILES: COC=1C(=CC2=C(N=C3C(NC(NC3=N2)=O)=O)C1)OC
  6. 7,8-difluoro-1,3-dimethylbenzo[g]pteridine-2,4(1H,3H)-dione

    CAS No.: 332029-31-9
    Catalog No.: TQP1698
    Purity: 95%
    MF: C12H8F2N4O2
    MW: 278.218
    Storage: 2-8 degree Celsius
    SMILES: FC=1C(=CC2=C(N=C3C(N(C(N(C3=N2)C)=O)C)=O)C1)F
  7. 7,8-difluorobenzo[g]pteridine-2,4(1H,3H)-dione

    CAS No.: 332029-30-8
    Catalog No.: TQP1697
    Purity: 95%
    MF: C10H4F2N4O2
    MW: 250.164
    Storage: 2-8 degree Celsius
    SMILES: FC=1C(=CC2=C(N=C3C(NC(NC3=N2)=O)=O)C1)F
  8. 4,6-dioxo-2,4,5,6-tetrahydro-1H-benzo[g]imidazo[1,2,3-ij]pteridin-12-ium chloride

    CAS No.: 114853-42-8
    Catalog No.: TQP1696
    Purity: 95%
    MF: C12H9ClN4O2
    MW: 276.683
    Storage: 2-8 degree Celsius
    SMILES: [Cl-].O=C1N2C3=[N+](C4=C(N=C3C(N1)=O)C=CC=C4)CC2
  9. 6,8-dimethylbenzo[g]pteridine-2,4(1H,3H)-dione

    CAS No.: 76127-02-1
    Catalog No.: TQP1695
    Purity: 95%
    MF: C12H10N4O2
    MW: 242.238
    Storage: 2-8 degree Celsius
    SMILES: CC1=CC(=CC2=C1N=C1C(NC(NC1=N2)=O)=O)C
  10. 1,3,7-trimethylbenzo[g]pteridine-2,4(1H,3H)-dione

    CAS No.: 2962-87-0
    Catalog No.: TQP1694
    Purity: 95%
    MF: C13H12N4O2
    MW: 256.265
    Storage: 2-8 degree Celsius
    SMILES: CN1C(N(C(C2=NC3=C(N=C12)C=CC(=C3)C)=O)C)=O
Loading ...Load More ...
Set Descending Direction

   

Items 1 to 10 of 27 total

  1. 1
  2. 2
  3. 3