•  
SSL
0item(s)

You have no items in your shopping cart.

Product was successfully added to your shopping cart.

Benzoimidazoles

Set Ascending Direction

   

Items 11 to 20 of 607 total

  1. 1
  2. 2
  3. 3
  4. 4
  5. 5
  1. 6-methyl-1H-benzo[d]imidazole-5-carbonitrile

    CAS No.: 952511-47-6
    Catalog No.: 100750
    Purity: 95%
    MF: C9H7N3
    MW: 157.176
    Storage: 2-8 degree Celsius
  2. 6-methyl-1-(tetrahydro-2H-pyran-2-yl)-1H-benzo[d]imidazole-5-carbonitrile

    CAS No.: 1407180-86-2
    Catalog No.: 100751
    Purity: 95%
    MF: C14H15N3O
    MW: 241.294
    Storage: 2-8 degree Celsius
  3. 5-amino-4-chloro-6-fluorobenzimidazole

    CAS No.: 117275-51-1
    Catalog No.: 100904
    Purity: 95%
    MF: C7H5ClFN3
    MW: 185.589
    Storage: 2-8 degree Celsius
    SMILES: NC1=C(F)C=C2NC=NC2=C1Cl
  4. 4-iodo-1H-benzo[d]imidazole

    CAS No.: 51288-04-1
    Catalog No.: 101116
    Purity: 95%
    MF: C7H5IN2
    MW: 244.035
    Storage: 2-8 degree Celsius
    SMILES: IC1=C2N=CNC2=CC=C1
  5. (4-methyl-1-(tetrahydro-2H-pyran-2-yl)-1H-benzo[d]imidazol-5-yl)methanamine

    CAS No.: 1425933-32-9
    Catalog No.: 101191
    Purity: 95%
    MF: C14H19N3O
    MW: 245.326
    Storage: 2-8 degree Celsius
    SMILES: CC1=C2N=CN(C3CCCCO3)C2=CC=C1CN
  6. 5,6-dimethyl-1H-benzo[d]imidazole-2(3H)-thione

    CAS No.: 3287-79-4
    Catalog No.: 101229
    Purity: 95%
    MF: C9H10N2S
    MW: 178.26
    Storage: 2-8 degree Celsius
    SMILES: CC1=C(C)C=C2NC(=S)NC2=C1
  7. 2-bromo-5,6-dimethyl-1H-benzo[d]imidazole

    CAS No.: 1189164-12-2
    Catalog No.: 101230
    Purity: 95%
    MF: C9H9BrN2
    MW: 225.089
    Storage: 2-8 degree Celsius
    SMILES: CC1=C(C)C=C2N=C(Br)NC2=C1
  8. 3-(5,6-dimethyl-1H-benzo[d]imidazol-2-ylamino)propan-1-ol

    CAS No.: 301163-47-3
    Catalog No.: 101231
    Purity: 95%
    MF: C12H17N3O
    MW: 219.288
    Storage: 2-8 degree Celsius
    SMILES: CC1=C(C)C=C2N=C(NCCCO)NC2=C1
  9. 2-difluoromethyl-1H-benzoimidazole

    CAS No.: 705-09-9
    Catalog No.: 101294
    Purity: 95%
    MF: C8H6F2N2
    MW: 168.146
    Storage: 2-8 degree Celsius
  10. 5,6-dichloro-2-methyl-1H-benzo[d]imidazole

    CAS No.: 6478-79-1
    Catalog No.: 101458
    Purity: 95%
    MF: C8H6Cl2N2
    MW: 201.056
    Storage: 2-8 degree Celsius
    SMILES: CC1=NC2=CC(Cl)=C(Cl)C=C2N1
Loading ...Load More ...
Set Ascending Direction

   

Items 11 to 20 of 607 total

  1. 1
  2. 2
  3. 3
  4. 4
  5. 5