•  
SSL
0item(s)

You have no items in your shopping cart.

Product was successfully added to your shopping cart.

Benzoimidazoles

Set Descending Direction

   

Items 1 to 10 of 607 total

  1. 1
  2. 2
  3. 3
  4. 4
  5. 5
  1. 5-bromo-6-methyl-1H-benzo[d]imidazole

    CAS No.: 116106-16-2
    Catalog No.: 100184
    Purity: 95%
    MF: C8H7BrN2
    MW: 211.062
    Storage: 2-8 degree Celsius
    SMILES: CC1=C(Br)C=C2N=CNC2=C1
  2. 5-bromo-4-methyl-1H-benzo[d]imidazole

    CAS No.: 952511-48-7
    Catalog No.: 100185
    Purity: 95%
    MF: C8H7BrN2
    MW: 211.062
    Storage: 2-8 degree Celsius
    SMILES: CC1=C2N=CNC2=CC=C1Br
  3. 6-bromo-1-tert-butyl-1H-benzo[d]imidazole

    CAS No.: 1163707-71-8
    Catalog No.: 100411
    Purity: 95%
    MF: C11H13BrN2
    MW: 253.143
    Storage: 2-8 degree Celsius
  4. 6-bromo-1-tert-butyl-2-methyl-1H-benzo[d]imidazole

    CAS No.: 1217486-78-6
    Catalog No.: 100414
    Purity: 95%
    MF: C12H15BrN2
    MW: 267.17
    Storage: 2-8 degree Celsius
    SMILES: CC1=NC2=CC=C(Br)C=C2N1C(C)(C)C
  5. 6-bromo-1-tert-butyl-2-ethoxy-2-methyl-2,3-dihydro-1H-benzo[d]imidazole

    CAS No.: 1217486-79-7
    Catalog No.: 100415
    Purity: 95%
    MF: C14H21BrN2O
    MW: 313.239
    Storage: 2-8 degree Celsius
    SMILES: CCOC1(C)NC2=CC=C(Br)C=C2N1C(C)(C)C
  6. 6-bromo-1-ethyl-1H-benzo[d]imidazole

    CAS No.: 813449-00-2
    Catalog No.: 100416
    Purity: 95%
    MF: C9H9BrN2
    MW: 225.089
    Storage: 2-8 degree Celsius
  7. 5-(1-tert-butyl-1H-benzo[d]imidazol-6-yl)thiazol-2-amine

    CAS No.: 1395492-68-8
    Catalog No.: 100452
    Purity: 95%
    MF: C14H16N4S
    MW: 272.377
    Storage: 2-8 degree Celsius
  8. 5-(1-ethyl-1H-benzo[d]imidazol-6-yl)-4-methylthiazol-2-amine

    CAS No.: 1395492-57-5
    Catalog No.: 100454
    Purity: 95%
    MF: C13H14N4S
    MW: 258.35
    Storage: 2-8 degree Celsius
  9. 5-(1-tert-butyl-2-methyl-1H-benzo[d]imidazol-6-yl)thiazol-2-amine

    CAS No.: 1395492-59-7
    Catalog No.: 100455
    Purity: 95%
    MF: C15H18N4S
    MW: 286.404
    Storage: 2-8 degree Celsius
    SMILES: CC1=NC2=CC=C(C=C2N1C(C)(C)C)C1=CN=C(N)S1
  10. 5-(4-bromo-2-chlorophenylamino)-4-fluoro-1-methyl-1H-benzo[d]imidazole-6-carbonitrile

    CAS No.: 917980-15-5
    Catalog No.: 100646
    Purity: 95%
    MF: C15H9BrClFN4
    MW: 379.62
    Storage: 2-8 degree Celsius
    SMILES: CN1C=NC2=C(F)C(NC3=CC=C(Br)C=C3Cl)=C(C=C12)C#N
Loading ...Load More ...
Set Descending Direction

   

Items 1 to 10 of 607 total

  1. 1
  2. 2
  3. 3
  4. 4
  5. 5