•  
SSL
0item(s)

You have no items in your shopping cart.

Product was successfully added to your shopping cart.

Benzofurans

Set Descending Direction

   

Items 21 to 30 of 535 total

  1. 1
  2. 2
  3. 3
  4. 4
  5. 5
  1. 6-fluoro-4-nitroisobenzofuran-1(3H)-one

    CAS No.: 1207453-90-4
    Catalog No.: 104156
    Purity: 95%
    MF: C8H4FNO4
    MW: 197.121
    Storage: 2-8 degree Celsius
    SMILES: [O-][N+](=O)C1=CC(F)=CC2=C1COC2=O
  2. 2-methylbenzofuran-6-ol

    CAS No.: 54584-24-6
    Catalog No.: 104447
    Purity: 95%
    MF: C9H8O2
    MW: 148.161
    Storage: 2-8 degree Celsius
    SMILES: CC1=CC2=CC=C(O)C=C2O1
  3. (Z)-6-fluoro-3-((1-methyl-1H-1,2,4-triazol-5-yl)methylene)-4-nitroisobenzofuran-1(3H)-one

    CAS No.: 1322616-34-1
    Catalog No.: 104588
    Purity: 95%
    MF: C12H7FN4O4
    MW: 290.21
    Storage: 2-8 degree Celsius
    SMILES: CN1N=CN=C1\C=C1/OC(=O)C2=C1C(=CC(F)=C2)[N+]([O-])=O
  4. benzofuran-5-ylboronic acid

    CAS No.: 331834-13-0
    Catalog No.: 105054
    Purity: 95%
    MF: C8H7BO3
    MW: 161.953
    Storage: 2-8 degree Celsius
  5. benzofuran-5-ylmethanesulfonyl chloride

    CAS No.: 869885-60-9
    Catalog No.: 105055
    Purity: 95%
    MF: C9H7ClO3S
    MW: 230.672
    Storage: 2-8 degree Celsius
  6. 2,8-dibromo dibenzofuran

    CAS No.: 10016-52-1
    Catalog No.: 105350
    Purity: 95%
    MF: C12H6Br2O
    MW: 325.987
    Storage: 2-8 degree Celsius
  7. 3-bromobenzofuran

    CAS No.: 59214-70-9
    Catalog No.: 105401
    Purity: 95%
    MF: C8H5BrO
    MW: 197.031
    Storage: 2-8 degree Celsius
    SMILES: BrC1=COC2=CC=CC=C12
  8. 5-bromobenzofuran

    CAS No.: 23145-07-5
    Catalog No.: 105606
    Purity: 95%
    MF: C8H5BrO
    MW: 197.031
    Storage: 2-8 degree Celsius
  9. 3-bromophthalic anhydride

    CAS No.: 82-73-5
    Catalog No.: 105656
    Purity: 95%
    MF: C8H3BrO3
    MW: 227.013
    Storage: 2-8 degree Celsius
    SMILES: BrC1=C2C(=O)OC(=O)C2=CC=C1
  10. 7-iodobenzofuran-5-sulfonyl chloride

    CAS No.: 856678-58-5
    Catalog No.: 105952
    Purity: 95%
    MF: C8H4ClIO3S
    MW: 342.541
    Storage: 2-8 degree Celsius
Loading ...Load More ...
Set Descending Direction

   

Items 21 to 30 of 535 total

  1. 1
  2. 2
  3. 3
  4. 4
  5. 5