•  
SSL
0item(s)

You have no items in your shopping cart.

Product was successfully added to your shopping cart.

Benzodioxoles

Set Descending Direction

   

Items 1 to 10 of 134 total

  1. 1
  2. 2
  3. 3
  4. 4
  5. 5
  1. 1-trifluoromethyl-1,2-benziodoxol-3(1H)-one

    CAS No.: 887144-94-7
    Catalog No.: 102145
    Purity: 95%
    MF: C8H6F3IO2
    MW: 318.032
    Storage: 2-8 degree Celsius
    SMILES: FC(F)(F)[I]1OC(=O)C2=CC=CC=C12
  2. 3,4-methylenedioxy-beta-nitrostyrene

    CAS No.: 1485-00-3
    Catalog No.: 102191
    Purity: 95%
    MF: C9H7NO4
    MW: 193.158
    Storage: 2-8 degree Celsius
    SMILES: [O-][N+](=O)\C=C\C1=CC=C2OCOC2=C1
  3. 2,2-dimethylbenzo[d][1,3]dioxol-5-amine

    CAS No.: 6324-89-6
    Catalog No.: 102267
    Purity: 95%
    MF: C9H11NO2
    MW: 165.192
    Storage: 2-8 degree Celsius
    SMILES: CC1(C)OC2=CC=C(N)C=C2O1
  4. benzo[d][1,3]dioxole-5-sulfonyl chloride

    CAS No.: 115010-10-1
    Catalog No.: 102611
    Purity: 95%
    MF: C7H5ClO4S
    MW: 220.633
    Storage: 2-8 degree Celsius
    SMILES: ClS(=O)(=O)C1=CC=C2OCOC2=C1
  5. (5-bromobenzo[d][1,3]dioxol-7-yl)methanamine

    CAS No.: 887581-73-9
    Catalog No.: 103441
    Purity: 95%
    MF: C8H8BrNO2
    MW: 230.061
    Storage: 2-8 degree Celsius
  6. 4-(benzo[d][1,3]dioxol-5-yl)-4-hydroxycyclohexanone

    CAS No.: 150019-57-1
    Catalog No.: 105053
    Purity: 95%
    MF: C13H14O4
    MW: 234.251
    Storage: 2-8 degree Celsius
  7. (S)-1-(benzo[d][1,3]dioxol-5-yl)ethanamine

    CAS No.: 210488-52-1
    Catalog No.: 106171
    Purity: 95%
    MF: C9H11NO2
    MW: 165.192
    Storage: 2-8 degree Celsius
  8. (R)-1-(benzo[d][1,3]dioxol-5-yl)ethanamine

    CAS No.: 210488-54-3
    Catalog No.: 106172
    Purity: 95%
    MF: C9H11NO2
    MW: 165.192
    Storage: 2-8 degree Celsius
  9. 2-(benzo[d][1,3]dioxol-5-yl)acetic acid

    CAS No.: 2861-28-1
    Catalog No.: 106595
    Purity: 95%
    MF: C9H8O4
    MW: 180.159
    Storage: 2-8 degree Celsius
    SMILES: OC(=O)CC1=CC=C2OCOC2=C1
  10. benzo[d][1,3]dioxol-5-ylboronic acid

    CAS No.: 94839-07-3
    Catalog No.: 107740
    Purity: 95%
    MF: C7H7BO4
    MW: 165.941
    Storage: 2-8 degree Celsius
Loading ...Load More ...
Set Descending Direction

   

Items 1 to 10 of 134 total

  1. 1
  2. 2
  3. 3
  4. 4
  5. 5