•  
SSL
0item(s)

You have no items in your shopping cart.

Product was successfully added to your shopping cart.

Benzodioxines

Set Descending Direction

   

Items 61 to 70 of 113 total

  1. 5
  2. 6
  3. 7
  4. 8
  5. 9
  1. (2,3-dihydrobenzo[b][1,4]dioxin-6-yl)(piperazin-1-yl)methanone

    CAS No.: 926189-75-5
    Catalog No.: GS3379
    Purity: 95%
    MF: C13H16N2O3
    MW: 248.282
    Storage: 2-8 degree Celsius
    SMILES: O1C2=C(OCC1)C=C(C=C2)C(=O)N2CCNCC2
  2. (7-chloro-2,3-dihydrobenzo[b][1,4]dioxin-6-yl)(piperazin-1-yl)methanone

    CAS No.: 1225166-75-5
    Catalog No.: GS3438
    Purity: 95%
    MF: C13H15ClN2O3
    MW: 282.727
    Storage: 2-8 degree Celsius
    SMILES: ClC=1C(=CC2=C(OCCO2)C1)C(=O)N1CCNCC1
  3. 3-(2,3-dihydrobenzo[b][1,4]dioxin-6-yl)azetidine

    CAS No.: 1260679-37-5
    Catalog No.: GS3729
    Purity: 95%
    MF: C11H13NO2
    MW: 191.23
    Storage: 2-8 degree Celsius
    SMILES: O1C2=C(OCC1)C=C(C=C2)C2CNC2
  4. pinanediol talabostat boronate

    CAS No.: 160332-26-3
    Catalog No.: HKP0103
    Purity: 95%
    MF: C19H33BN2O3
    MW: 348.296
    Storage: 2-8 degree Celsius
    SMILES: N[C@H](C(=O)N1[C@@H](CCC1)B1O[C@]2([C@@H]3C([C@H](C[C@H]2O1)C3)(C)C)C)C(C)C
  5. methyl 6-bromo-2,3-dihydro-1,4-benzodioxine-3-carboxylate

    CAS No.: 2090915-29-8
    Catalog No.: HKP0265
    Purity: 95%
    MF: C10H9BrO4
    MW: 273.082
    Storage: 2-8 degree Celsius
    SMILES: BrC1=CC2=C(OCC(O2)C(=O)OC)C=C1
  6. 7-bromo-2,3-dihydro-1,4-benzodioxine-2-carboxylic acid

    CAS No.: 1256822-33-9
    Catalog No.: HKP0266
    Purity: 95%
    MF: C9H7BrO4
    MW: 259.055
    Storage: 2-8 degree Celsius
    SMILES: BrC=1C=CC2=C(OC(CO2)C(=O)O)C1
  7. 2-((benzyloxy)methyl)-7-bromo-2,3-dihydrobenzo[b][1,4]dioxine

    CAS No.: 527680-79-1
    Catalog No.: HKP0267
    Purity: 95%
    MF: C16H15BrO3
    MW: 335.197
    Storage: 2-8 degree Celsius
    SMILES: C(C1=CC=CC=C1)OCC1COC2=C(O1)C=C(C=C2)Br
  8. 3-((benzyloxy)methyl)-2,3-dihydrobenzo[b][1,4]dioxine-6-carboxylic acid

    CAS No.: 527680-80-4
    Catalog No.: HKP0268
    Purity: 95%
    MF: C17H16O5
    MW: 300.31
    Storage: 2-8 degree Celsius
    SMILES: C(C1=CC=CC=C1)OCC1OC2=C(OC1)C=CC(=C2)C(=O)O
  9. (6-methylsulfonyl-2,3-dihydro-1,4-benzodioxin-3-yl)methanol

    CAS No.: 1193708-69-8
    Catalog No.: HKP0269
    Purity: 95%
    MF: C10H12O5S
    MW: 244.268
    Storage: 2-8 degree Celsius
    SMILES: CS(=O)(=O)C1=CC2=C(OCC(O2)CO)C=C1
  10. (S)-(7-bromo-2,3-dihydrobenzo[b][1,4]dioxin-2-yl)methanol

    CAS No.: 187543-81-3
    Catalog No.: HKP0270
    Purity: 95%
    MF: C9H9BrO3
    MW: 245.072
    Storage: 2-8 degree Celsius
    SMILES: BrC=1C=CC2=C(O[C@H](CO2)CO)C1
Loading ...Load More ...
Set Descending Direction

   

Items 61 to 70 of 113 total

  1. 5
  2. 6
  3. 7
  4. 8
  5. 9