•  
SSL
0item(s)

You have no items in your shopping cart.

Product was successfully added to your shopping cart.

Benzodiazepines

Set Descending Direction

   

Items 1 to 10 of 82 total

  1. 1
  2. 2
  3. 3
  4. 4
  5. 5
  1. 11-bromo-1,2,3,4,6,7,14,14a-octahydrobenzo[4,5]imidazo[1,2-d]pyrido[2,1-g][1,4]diazepine

    CAS No.: 1272320-76-9
    Catalog No.: TQP0193
    Purity: 95%
    MF: C15H18BrN3
    MW: 320.234
    Storage: 2-8 degree Celsius
    SMILES: BrC=1C=CC2=C(N=C3N2CCN2C(C3)CCCC2)C1
  2. 8-(trifluoromethyl)-5H-dibenzo[b,e][1,4]diazepin-11(10H)-one

    CAS No.: 1554-96-7
    Catalog No.: TQR1766
    Purity: 95%
    MF: C14H9F3N2O
    MW: 278.233
    Storage: 2-8 degree Celsius
    SMILES: FC(C=1C=CC2=C(NC(C3=C(N2)C=CC=C3)=O)C1)(F)F
  3. 2-methoxy-5H-dibenzo[b,e][1,4]diazepin-11(10H)-one

    CAS No.: 167997-02-6
    Catalog No.: TQR1765
    Purity: 95%
    MF: C14H12N2O2
    MW: 240.262
    Storage: 2-8 degree Celsius
    SMILES: COC1=CC2=C(NC3=C(NC2=O)C=CC=C3)C=C1
  4. 8-methoxy-5H-dibenzo[b,e][1,4]diazepin-11(10H)-one

    CAS No.: 93533-11-0
    Catalog No.: TQR1764
    Purity: 95%
    MF: C14H12N2O2
    MW: 240.262
    Storage: 2-8 degree Celsius
    SMILES: COC=1C=CC2=C(NC(C3=C(N2)C=CC=C3)=O)C1
  5. 8-chloro-2-methoxy-5H-dibenzo[b,e][1,4]diazepin-11(10H)-one

    CAS No.: 67104-22-7
    Catalog No.: TQR1763
    Purity: 95%
    MF: C14H11ClN2O2
    MW: 274.707
    Storage: 2-8 degree Celsius
    SMILES: ClC=1C=CC2=C(NC(C3=C(N2)C=CC(=C3)OC)=O)C1
  6. 2-nitro-5H-dibenzo[b,e][1,4]diazepin-11(10H)-one

    CAS No.: 54255-81-1
    Catalog No.: TQR1762
    Purity: 95%
    MF: C13H9N3O3
    MW: 255.233
    Storage: 2-8 degree Celsius
    SMILES: [N+](=O)([O-])C1=CC2=C(NC3=C(NC2=O)C=CC=C3)C=C1
  7. 7-chloro-5H-dibenzo[b,e][1,4]diazepin-11(10H)-one

    CAS No.: 49780-87-2
    Catalog No.: TQR1761
    Purity: 95%
    MF: C13H9ClN2O
    MW: 244.681
    Storage: 2-8 degree Celsius
    SMILES: ClC1=CC2=C(NC(C3=C(N2)C=CC=C3)=O)C=C1
  8. 2-chloro-5H-dibenzo[b,e][1,4]diazepin-11(10H)-one

    CAS No.: 82096-44-4
    Catalog No.: TQR1760
    Purity: 95%
    MF: C13H9ClN2O
    MW: 244.681
    Storage: 2-8 degree Celsius
    SMILES: ClC1=CC2=C(NC3=C(NC2=O)C=CC=C3)C=C1
  9. 5H-dibenzo[b,e][1,4]diazepin-11(10H)-one

    CAS No.: 5814-41-5
    Catalog No.: TQR1759
    Purity: 95%
    MF: C13H10N2O
    MW: 210.236
    Storage: 2-8 degree Celsius
    SMILES: C1=CC=CC=2NC3=C(NC(C21)=O)C=CC=C3
  10. tert-butyl 1-bromo-8-chloro-4H-benzo[f][1,2,4]triazolo[4,3-a][1,4]diazepine-5(6H)-carboxylate

    CAS No.: 1226808-02-1
    Catalog No.: TQR1517
    Purity: 95%
    MF: C15H16BrClN4O2
    MW: 399.676
    Storage: 2-8 degree Celsius
    SMILES: BrC1=NN=C2N1C1=C(CN(C2)C(=O)OC(C)(C)C)C=C(C=C1)Cl
Loading ...Load More ...
Set Descending Direction

   

Items 1 to 10 of 82 total

  1. 1
  2. 2
  3. 3
  4. 4
  5. 5