•  
SSL
0item(s)

You have no items in your shopping cart.

Product was successfully added to your shopping cart.

Benzoazepines

Set Descending Direction

   

Items 21 to 30 of 148 total

  1. 1
  2. 2
  3. 3
  4. 4
  5. 5
  1. 6,7-dichloro-3-methyl-2,3,4,5-tetrahydro-1H-benzo[d]azepine

    CAS No.: 461435-74-5
    Catalog No.: 135461
    Purity: 95%
    MF: C11H13Cl2N
    MW: 230.138
    Storage: 2-8 degree Celsius
  2. 6-chloro-7-nitro-2,3,4,5-tetrahydro-1H-benzo[d]azepine

    CAS No.: 461435-44-9
    Catalog No.: 135462
    Purity: 95%
    MF: C10H11ClN2O2
    MW: 226.663
    Storage: 2-8 degree Celsius
  3. 6-chloro-2,3,4,5-tetrahydro-1H-benzo[d]azepine-7-carbonitrile

    CAS No.: 773049-24-4
    Catalog No.: 135463
    Purity: 95%
    MF: C11H11ClN2
    MW: 206.676
    Storage: 2-8 degree Celsius
  4. 6-chloro-7-fluoro-2,3,4,5-tetrahydro-1H-benzo[d]azepine

    CAS No.: 755747-63-8
    Catalog No.: 135464
    Purity: 95%
    MF: C10H11ClFN
    MW: 199.656
    Storage: 2-8 degree Celsius
  5. 6,7-dichloro-2,3,4,5-tetrahydro-1H-benzo[d]azepine

    CAS No.: 180160-89-8
    Catalog No.: 135465
    Purity: 95%
    MF: C10H11Cl2N
    MW: 216.111
    Storage: 2-8 degree Celsius
  6. 7-bromo-6-chloro-2,3,4,5-tetrahydro-1H-benzo[d]azepine

    CAS No.: 461436-12-4
    Catalog No.: 135466
    Purity: 95%
    MF: C10H11BrClN
    MW: 260.562
    Storage: 2-8 degree Celsius
  7. 6-chloro-7-methoxy-2,3,4,5-tetrahydro-1H-benzo[d]azepine

    CAS No.: 461435-56-3
    Catalog No.: 135467
    Purity: 95%
    MF: C11H14ClNO
    MW: 211.692
    Storage: 2-8 degree Celsius
  8. 6-chloro-N-methyl-2,3,4,5-tetrahydro-1H-benzo[d]azepin-7-amine

    CAS No.: 751475-07-7
    Catalog No.: 135468
    Purity: 95%
    MF: C11H15ClN2
    MW: 210.708
    Storage: 2-8 degree Celsius
  9. 7,8,9,10-tetrahydro-6H-benzofuro[6,7-d]azepine

    CAS No.: 730935-21-4
    Catalog No.: 135469
    Purity: 95%
    MF: C12H13NO
    MW: 187.242
    Storage: 2-8 degree Celsius
  10. 5H-dibenzo[b,e]azepine-6,11-dione

    CAS No.: 1143-50-6
    Catalog No.: 146038
    Purity: 95%
    MF: C14H9NO2
    MW: 223.231
    Storage: 2-8 degree Celsius
    SMILES: O=C1NC2=C(C=CC=C2)C(=O)C2=C1C=CC=C2
Loading ...Load More ...
Set Descending Direction

   

Items 21 to 30 of 148 total

  1. 1
  2. 2
  3. 3
  4. 4
  5. 5