•  
SSL
0item(s)

You have no items in your shopping cart.

Product was successfully added to your shopping cart.

Benzoazepines

Set Descending Direction

   

Items 1 to 10 of 148 total

  1. 1
  2. 2
  3. 3
  4. 4
  5. 5
  1. 1,3,4,5-tetrahydro-2H-1-benzazepin-2-one

    CAS No.: 4424-80-0
    Catalog No.: 103150
    Purity: 95%
    MF: C10H11NO
    MW: 161.204
    Storage: 2-8 degree Celsius
    SMILES: O=C1CCCC2=CC=CC=C2N1
  2. tert-butyl 5-amino-2,3,4,5-tetrahydro-1H-benzo[b]azepine-1-carboxylate

    CAS No.: 811841-95-9
    Catalog No.: 105040
    Purity: 95%
    MF: C15H22N2O2
    MW: 262.353
    Storage: 2-8 degree Celsius
    SMILES: CC(C)(C)OC(=O)N1CCCC(N)C2=CC=CC=C12
  3. 4-amino-4,5-dihydro-1H-benzo[b]azepin-2(3H)-one

    CAS No.: 887578-14-5
    Catalog No.: 105041
    Purity: 95%
    MF: C10H12N2O
    MW: 176.219
    Storage: 2-8 degree Celsius
    SMILES: NC1CC2=CC=CC=C2NC(=O)C1
  4. 8-amino-4,5-dihydro-1H-benzo[b]azepin-2(3H)-one

    CAS No.: 22246-76-0
    Catalog No.: 105042
    Purity: 95%
    MF: C10H12N2O
    MW: 176.219
    Storage: 2-8 degree Celsius
  5. 3,4-dihydro-1H-benzo[b]azepin-5(2H)-one

    CAS No.: 1127-74-8
    Catalog No.: 106123
    Purity: 95%
    MF: C10H11NO
    MW: 161.204
    Storage: 2-8 degree Celsius
  6. (S)-1-amino-3-methyl-4,5-dihydro-1H-benzo[d]azepin-2(3H)-one

    CAS No.: 425663-71-4
    Catalog No.: 108799
    Purity: 95%
    MF: C11H14N2O
    MW: 190.246
    Storage: 2-8 degree Celsius
  7. 2,3,4,5-tetrahydro-1H-2-benzazepine

    CAS No.: 7216-22-0
    Catalog No.: 109523
    Purity: 95%
    MF: C10H13N
    MW: 147.221
    Storage: 2-8 degree Celsius
  8. 8-nitro-2,3,4,5-tetrahydro-1H-benzo[c]azepine

    CAS No.: 223915-75-1
    Catalog No.: 109524
    Purity: 95%
    MF: C10H12N2O2
    MW: 192.218
    Storage: 2-8 degree Celsius
  9. 8-amino-2,3,4,5-tetrahydro-1H-benzo[c]azepine

    CAS No.: 72232-25-8
    Catalog No.: 109525
    Purity: 95%
    MF: C10H14N2
    MW: 162.236
    Storage: 2-8 degree Celsius
  10. 2,3,4,5-tetrahydro-1H-2-benzazepine hydrochloride

    CAS No.: 17724-36-6
    Catalog No.: 109661
    Purity: 95%
    MF: C10H14ClN
    MW: 183.682
    Storage: 2-8 degree Celsius
Loading ...Load More ...
Set Descending Direction

   

Items 1 to 10 of 148 total

  1. 1
  2. 2
  3. 3
  4. 4
  5. 5