•  
SSL
0item(s)

You have no items in your shopping cart.

Product was successfully added to your shopping cart.

Bcr-Abl

Set Descending Direction

   

Items 1 to 10 of 21 total

  1. 1
  2. 2
  3. 3
  1. Rebastinib; DCC-2036

    CAS No.: 1020172-07-9
    Catalog No.: 113196
    Purity: 95%
    MF: C30H28FN7O3
    MW: 553.598
    Storage: 2-8 degree Celsius
    SMILES: CNC(=O)C1=NC=CC(OC2=CC=C(NC(=O)NC3=CC(=NN3C3=CC=C4N=CC=CC4=C3)C(C)(C)C)C(F)=C2)=C1
  2. Asciminib hydrochloride

    CAS No.: 2119669-71-3
    Catalog No.: WLZ3771
    Purity: 95%
    MF: C20H19Cl2F2N5O3
    MW: 486.306
    Storage: 2-8 degree Celsius
    SMILES: Cl.ClC(OC1=CC=C(C=C1)NC(=O)C=1C=NC(=C(C1)C1=NNC=C1)N1C[C@@H](CC1)O)(F)F
  3. Vodobatinib

    CAS No.: 1388803-90-4
    Catalog No.: WLZ0211
    Purity: 95%
    MF: C27H20ClN3O2
    MW: 453.929
    Storage: 2-8 degree Celsius
    SMILES: ClC1=C(C(=O)NNC(C2=CC(=C(C=C2)C)C#CC=2C=NC3=CC=CC=C3C2)=O)C(=CC=C1)C
  4. Adaphostin

    CAS No.: 241127-58-2
    Catalog No.: 194736
    Purity: 95%
    MF: C24H27NO4
    MW: 393.483
    Storage: 2-8 degree Celsius
    SMILES: OC1=C(CNC2=CC=C(C(=O)OC34CC5CC(CC(C3)C5)C4)C=C2)C=C(C=C1)O
  5. GZD824 dimesylate

    CAS No.: 1421783-64-3
    Catalog No.: 141876
    Purity: 95%
    MF: C31H35F3N6O7S2
    MW: 724.784
    Storage: 2-8 degree Celsius
    SMILES: CS(O)(=O)=O.CS(O)(=O)=O.CN1CCN(CC2=CC=C(NC(=O)C3=CC=C(C)C(=C3)C#CC3=CN=C4NN=CC4=C3)C=C2C(F)(F)F)CC1
  6. Radotinib

    CAS No.: 926037-48-1
    Catalog No.: 152166
    Purity: 95%
    MF: C27H21F3N8O
    MW: 530.514
    Storage: 2-8 degree Celsius
    SMILES: CC1=CN(C=N1)C1=CC(=CC(NC(=O)C2=CC(NC3=NC(=CC=N3)C3=CN=CC=N3)=C(C)C=C2)=C1)C(F)(F)F
  7. GNF-7

    CAS No.: 839706-07-9
    Catalog No.: 152168
    Purity: 95%
    MF: C28H24F3N7O2
    MW: 547.541
    Storage: 2-8 degree Celsius
    SMILES: CN1C(=O)N(CC2=C1N=C(NC1=CC=C(C)N=C1)N=C2)C1=C(C)C=CC(NC(=O)C2=CC(=CC=C2)C(F)(F)F)=C1
  8. Bafetinib; INNO-406

    CAS No.: 859212-16-1
    Catalog No.: 151421
    Purity: 95%
    MF: C30H31F3N8O
    MW: 576.627
    Storage: 2-8 degree Celsius
    SMILES: CN(C)[C@H]1CCN(CC2=C(C=C(C=C2)C(=O)NC2=CC(NC3=NC(=CC=N3)C3=CN=CN=C3)=C(C)C=C2)C(F)(F)F)C1
  9. GZD824

    CAS No.: 1257628-77-5
    Catalog No.: 140122
    Purity: 95%
    MF: C29H27F3N6O
    MW: 532.57
    Storage: 2-8 degree Celsius
    SMILES: CN1CCN(CC2=C(C=C(NC(=O)C3=CC(C#CC4=CC5=C(NN=C5)N=C4)=C(C)C=C3)C=C2)C(F)(F)F)CC1
  10. Nilotinib hydrochloride anhydrous

    CAS No.: 923288-95-3
    Catalog No.: 112889
    Purity: 95%
    MF: C28H23ClF3N7O
    MW: 565.987
    Storage: 2-8 degree Celsius
Loading ...Load More ...
Set Descending Direction

   

Items 1 to 10 of 21 total

  1. 1
  2. 2
  3. 3