•  
SSL
0item(s)

You have no items in your shopping cart.

Product was successfully added to your shopping cart.

Bcl-2

Set Descending Direction

   

Items 1 to 10 of 25 total

  1. 1
  2. 2
  3. 3
  1. A-1331852

    CAS No.: 1430844-80-6
    Catalog No.: 169587
    Purity: 95%
    MF: C38H38N6O3S
    MW: 658.828
    Storage: 2-8 degree Celsius
    SMILES: CC1=C(C=NN1CC12CC3CC(CC(C3)C1)C2)C1=CC=C(N=C1C(O)=O)N1CCC2=C(C1)C(=CC=C2)C(=O)NC1=NC2=CC=CC=C2S1
  2. VU0661013

    CAS No.: 2131184-57-9
    Catalog No.: ZB1583
    Purity: 95%
    MF: C39H39Cl2N5O4
    MW: 712.678
    Storage: 2-8 degree Celsius
    SMILES: ClC=1C=CC=2C(=C3N(C2C1C=1C(=NN(C1C)C)C)[C@@H](CN(C3=O)C3=CN(C1=CC=C(C=C31)C(=O)O)C)C)CCCOC3=CC(=C(C(=C3)C)Cl)C
  3. ML311

    CAS No.: 315698-17-0
    Catalog No.: 194638
    Purity: 95%
    MF: C23H24F3N3O
    MW: 415.459
    Storage: 2-8 degree Celsius
    SMILES: C(C)N1CCN(CC1)C(C1=CC=C2C=CC=NC2=C1O)C1=CC=C(C=C1)C(F)(F)F
  4. FX1

    CAS No.: 1426138-42-2
    Catalog No.: 186317
    Purity: 95%
    MF: C14H9ClN2O4S2
    MW: 368.823
    Storage: 2-8 degree Celsius
    SMILES: ClC=1C=C2/C(/C(NC2=CC1)=O)=C/1\C(N(C(S1)=S)CCC(=O)O)=O
  5. BZ-423

    CAS No.: 216691-95-1
    Catalog No.: 183260
    Purity: 95%
    MF: C27H21ClN2O2
    MW: 440.93
    Storage: 2-8 degree Celsius
    SMILES: CN1C2=CC=C(Cl)C=C2C(=NC(CC2=CC3=CC=CC=C3C=C2)C1=O)C1=CC=C(O)C=C1
  6. BH3I-1

    CAS No.: 300817-68-9
    Catalog No.: 171849
    Purity: 95%
    MF: C15H14BrNO3S2
    MW: 400.319
    Storage: 2-8 degree Celsius
    SMILES: CC(C)C(N1C(=S)S\C(=C\C2=CC=C(Br)C=C2)C1=O)C(O)=O
  7. A-1155463

    CAS No.: 1235034-55-5
    Catalog No.: 169617
    Purity: 95%
    MF: C35H32FN5O4S2
    MW: 669.804
    Storage: 2-8 degree Celsius
    SMILES: CN(C)CC#CC1=CC(F)=C(OCCCC2=C(N=C(S2)N2CCC3=C(C2)C(=CC=C3)C(=O)NC2=NC3=CC=CC=C3S2)C(O)=O)C=C1
  8. Gossypol

    CAS No.: 303-45-7
    Catalog No.: 159881
    Purity: 95%
    MF: C30H30O8
    MW: 518.562
    Storage: 2-8 degree Celsius
    SMILES: CC(C)C1=C2C=C(C)C(=C(O)C2=C(C=O)C(O)=C1O)C1=C(O)C2=C(C=O)C(O)=C(O)C(C(C)C)=C2C=C1C
  9. AT 101

    CAS No.: 90141-22-3
    Catalog No.: 149127
    Purity: 95%
    MF: C30H30O8
    MW: 518.562
    Storage: 2-8 degree Celsius
    SMILES: CC(C)C1=C2C=C(C)C(=C(O)C2=C(C=O)C(O)=C1O)C1=C(O)C2=C(C=O)C(O)=C(O)C(C(C)C)=C2C=C1C
  10. Desmorpholinyl Navitoclax-NH-Me

    CAS No.: 2365172-82-1
    Catalog No.: 195297
    Purity: 95%
    MF: C44H51ClF3N5O5S3
    MW: 918.57
    Storage: 2-8 degree Celsius
    SMILES: ClC1=CC=C(C=C1)C1=C(CC(CC1)(C)C)CN1CCN(CC1)C1=CC=C(C(=O)NS(=O)(=O)C2=CC(=C(C=C2)N[C@@H](CSC2=CC=CC=C2)CCNC)S(=O)(=O)C(F)(F)F)C=C1
Loading ...Load More ...
Set Descending Direction

   

Items 1 to 10 of 25 total

  1. 1
  2. 2
  3. 3