•  
SSL
0item(s)

You have no items in your shopping cart.

Product was successfully added to your shopping cart.

Aziridines

Set Descending Direction

   

Items 1 to 10 of 34 total

  1. 1
  2. 2
  3. 3
  4. 4
  1. (2S)-2-benzylaziridine

    CAS No.: 73058-30-7
    Catalog No.: 158512
    Purity: 95%
    MF: C9H11N
    MW: 133.194
    Storage: 2-8 degree Celsius
    SMILES: C([C@H]1CN1)C1=CC=CC=C1
  2. 2-formyl-1-trityl-aziridine

    CAS No.: 173277-15-1
    Catalog No.: 170619
    Purity: 95%
    MF: C22H19NO
    MW: 313.4
    Storage: 2-8 degree Celsius
    SMILES: O=CC1CN1C(C1=CC=CC=C1)(C1=CC=CC=C1)C1=CC=CC=C1
  3. methyl (2R)-1-(triphenylmethyl)aziridine-2-carboxylate

    CAS No.: 160233-42-1
    Catalog No.: 170721
    Purity: 95%
    MF: C23H21NO2
    MW: 343.426
    Storage: 2-8 degree Celsius
    SMILES: COC(=O)[C@H]1CN1C(C1=CC=CC=C1)(C1=CC=CC=C1)C1=CC=CC=C1
  4. (2R)-1-[(tert-butoxy)carbonyl]aziridine-2-carboxylic acid

    CAS No.: 1286768-92-0
    Catalog No.: 171204
    Purity: 95%
    MF: C8H13NO4
    MW: 187.195
    Storage: 2-8 degree Celsius
    SMILES: CC(C)(C)OC(=O)N1C[C@@H]1C(O)=O
  5. (S)-1-benzyl 2-methyl aziridine-1,2-dicarboxylate

    CAS No.: 104597-98-0
    Catalog No.: 188957
    Purity: 95%
    MF: C12H13NO4
    MW: 235.239
    Storage: 2-8 degree Celsius
    SMILES: [N@]1(C(C1)C(=O)OC)C(=O)OCC1=CC=CC=C1
  6. methyl 1-tritylaziridine-2-carboxylate

    CAS No.: 76357-18-1
    Catalog No.: 188999
    Purity: 95%
    MF: C23H21NO2
    MW: 343.426
    Storage: 2-8 degree Celsius
    SMILES: C(C1=CC=CC=C1)(C1=CC=CC=C1)(C1=CC=CC=C1)N1C(C1)C(=O)OC
  7. (R)-tert-Butyl 2-methylaziridine-1-carboxylate

    CAS No.: 129319-91-1
    Catalog No.: 192585
    Purity: 95%
    MF: C8H15NO2
    MW: 157.213
    Storage: 2-8 degree Celsius
    SMILES: CC1[N@@](C1)C(=O)OC(C)(C)C
  8. (S)-tert-Butyl 2-methylaziridine-1-carboxylate

    CAS No.: 197020-60-3
    Catalog No.: 192586
    Purity: 95%
    MF: C8H15NO2
    MW: 157.213
    Storage: 2-8 degree Celsius
    SMILES: CC1[N@](C1)C(=O)OC(C)(C)C
  9. (S)-methyl 1-tritylaziridine-2-carboxylate

    CAS No.: 75154-68-6
    Catalog No.: 155875
    Purity: 95%
    MF: C23H21NO2
    MW: 343.426
    Storage: 2-8 degree Celsius
    SMILES: COC(=O)[C@@H]1CN1C(C1=CC=CC=C1)(C1=CC=CC=C1)C1=CC=CC=C1
  10. (S)-1-tert-butyl 2-methyl aziridine-1,2-dicarboxylate

    CAS No.: 126496-79-5
    Catalog No.: 156129
    Purity: 95%
    MF: C9H15NO4
    MW: 201.222
    Storage: 2-8 degree Celsius
    SMILES: COC(=O)[C@@H]1CN1C(=O)OC(C)(C)C
Loading ...Load More ...
Set Descending Direction

   

Items 1 to 10 of 34 total

  1. 1
  2. 2
  3. 3
  4. 4