•  
SSL
0item(s)

You have no items in your shopping cart.

Product was successfully added to your shopping cart.

Azepanes

Set Descending Direction

   

Items 41 to 50 of 224 total

  1. 3
  2. 4
  3. 5
  4. 6
  5. 7
  1. (R)-tert-butyl azepan-3-ylcarbamate

    CAS No.: 1354351-56-6
    Catalog No.: 113962
    Purity: 95%
    MF: C11H22N2O2
    MW: 214.309
    Storage: 2-8 degree Celsius
  2. tert-butyl azepan-3-ylcarbamate

    CAS No.: 454451-26-4
    Catalog No.: 113963
    Purity: 95%
    MF: C11H22N2O2
    MW: 214.309
    Storage: 2-8 degree Celsius
  3. (R)-3-aminoazepan-2-one hydrochloride

    CAS No.: 26081-03-8
    Catalog No.: 113964
    Purity: 95%
    MF: C6H13ClN2O
    MW: 164.636
    Storage: 2-8 degree Celsius
  4. 1-methylazepan-4-one hydrochloride

    CAS No.: 19869-42-2
    Catalog No.: 129218
    Purity: 95%
    MF: C7H14ClNO
    MW: 163.648
    Storage: 2-8 degree Celsius
    SMILES: Cl.CN1CCCC(=O)CC1
  5. Ritonavir; A 84538; ABT 538; Abbott 84538; NSC 693184; RTV

    CAS No.: 155213-67-5
    Catalog No.: 129647
    Purity: 95%
    MF: C37H48N6O5S2
    MW: 720.962
    Storage: 2-8 degree Celsius
    SMILES: CC(C)[C@H](NC(=O)N(C)CC1=CSC(=N1)C(C)C)C(=O)N[C@H](C[C@H](O)[C@H](CC1=CC=CC=C1)NC(=O)OCC1=CN=CS1)CC1=CC=CC=C1
  6. Hexahydro-1H-azepin-4-ol hydrochloride

    CAS No.: 1159823-34-3
    Catalog No.: 129344
    Purity: 95%
    MF: C6H14ClNO
    MW: 151.637
    Storage: 2-8 degree Celsius
  7. Atazanavir sulfate; BMS-232632 sulfate

    CAS No.: 229975-97-7
    Catalog No.: 131311
    Purity: 95%
    MF: C38H54N6O11S
    MW: 802.948
    Storage: 2-8 degree Celsius
    SMILES: OS(O)(=O)=O.COC(=O)N[C@H](C(=O)N[C@@H](CC1=CC=CC=C1)[C@@H](O)CN(CC1=CC=C(C=C1)C1=CC=CC=N1)NC(=O)[C@@H](NC(=O)OC)C(C)(C)C)C(C)(C)C
  8. 1-benzyl-1,4-diazepan-5-one

    CAS No.: 55186-89-5
    Catalog No.: 131027
    Purity: 95%
    MF: C12H16N2O
    MW: 204.273
    Storage: 2-8 degree Celsius
  9. 4-methyl-1,4-diazepan-5-one

    CAS No.: 172314-56-6
    Catalog No.: 131028
    Purity: 95%
    MF: C6H12N2O
    MW: 128.175
    Storage: 2-8 degree Celsius
  10. tert-butyl 2-(hydroxymethyl)-1,4-oxazepane-4-carboxylate

    CAS No.: 1174020-52-0
    Catalog No.: 133661
    Purity: 95%
    MF: C11H21NO4
    MW: 231.292
    Storage: 2-8 degree Celsius
Loading ...Load More ...
Set Descending Direction

   

Items 41 to 50 of 224 total

  1. 3
  2. 4
  3. 5
  4. 6
  5. 7