•  
SSL
0item(s)

You have no items in your shopping cart.

Product was successfully added to your shopping cart.

Azepanes

Set Ascending Direction

   

Items 31 to 40 of 224 total

  1. 2
  2. 3
  3. 4
  4. 5
  5. 6
  1. (R)-tert-butyl 3-aminoazepane-1-carboxylate

    CAS No.: 1032684-85-7
    Catalog No.: 110198
    Purity: 95%
    MF: C11H22N2O2
    MW: 214.309
    Storage: 2-8 degree Celsius
  2. tert-butyl 3-aminoazepane-1-carboxylate

    CAS No.: 609789-17-5
    Catalog No.: 110259
    Purity: 95%
    MF: C11H22N2O2
    MW: 214.309
    Storage: 2-8 degree Celsius
    SMILES: CC(C)(C)OC(=O)N1CCCCC(N)C1
  3. 1,4-diazepan-2-one

    CAS No.: 99822-50-1
    Catalog No.: 110395
    Purity: 95%
    MF: C5H10N2O
    MW: 114.148
    Storage: 2-8 degree Celsius
  4. tert-butyl 3-oxo-1,4-diazepane-1-carboxylate

    CAS No.: 179686-38-5
    Catalog No.: 110396
    Purity: 95%
    MF: C10H18N2O3
    MW: 214.265
    Storage: 2-8 degree Celsius
  5. 1-methyl-1,4-diazepan-2-one

    CAS No.: 60565-89-1
    Catalog No.: 110397
    Purity: 95%
    MF: C6H12N2O
    MW: 128.175
    Storage: 2-8 degree Celsius
  6. 5-phenyl-1H-azepin-2(3H)-one

    CAS No.: 41789-70-2
    Catalog No.: 111616
    Purity: 95%
    MF: C12H11NO
    MW: 185.226
    Storage: 2-8 degree Celsius
  7. Nelfinavir Mesylate

    CAS No.: 159989-65-8
    Catalog No.: 112448
    Purity: 95%
    MF: C33H49N3O7S2
    MW: 663.903
    Storage: 2-8 degree Celsius
  8. 1-benzylazepan-4-one

    CAS No.: 1208-75-9
    Catalog No.: 112820
    Purity: 95%
    MF: C13H17NO
    MW: 203.285
    Storage: 2-8 degree Celsius
    SMILES: O=C1CCCN(CC2=CC=CC=C2)CC1
  9. 1-benzyl-5-bromoazepan-4-one hydrobromide

    CAS No.: 49569-46-2
    Catalog No.: 113190
    Purity: 95%
    MF: C13H17Br2NO
    MW: 363.093
    Storage: 2-8 degree Celsius
    SMILES: Br[H].BrC1CCN(CC2=CC=CC=C2)CCC1=O
  10. azepane-1-sulfonyl chloride

    CAS No.: 41483-72-1
    Catalog No.: 113918
    Purity: 95%
    MF: C6H12ClNO2S
    MW: 197.687
    Storage: 2-8 degree Celsius
Loading ...Load More ...
Set Ascending Direction

   

Items 31 to 40 of 224 total

  1. 2
  2. 3
  3. 4
  4. 5
  5. 6