•  
SSL
0item(s)

You have no items in your shopping cart.

Product was successfully added to your shopping cart.

Azabicycloes

Set Descending Direction

   

Items 1 to 10 of 604 total

  1. 1
  2. 2
  3. 3
  4. 4
  5. 5
  1. 3-tosyl-6-oxa-3-azabicyclo[3.1.0]hexane

    CAS No.: 159555-66-5
    Catalog No.: 100668
    Purity: 95%
    MF: C11H13NO3S
    MW: 239.296
    Storage: 2-8 degree Celsius
    SMILES: CC1=CC=C(C=C1)S(=O)(=O)N1CC2OC2C1
  2. 1,4-diazabicyclo[3.2.2]nonane

    CAS No.: 283-38-5
    Catalog No.: 101317
    Purity: 95%
    MF: C7H14N2
    MW: 126.203
    Storage: 2-8 degree Celsius
    SMILES: C1CN2CCC1NCC2
  3. 3-benzyl-3,7-diazabicyclo[3.3.0]octane

    CAS No.: 86732-22-1
    Catalog No.: 101335
    Purity: 95%
    MF: C13H18N2
    MW: 202.301
    Storage: 2-8 degree Celsius
    SMILES: C(N1CC2CNCC2C1)C1=CC=CC=C1
  4. 8-oxa-3-azabicyclo[3.2.1]octane hydrochloride

    CAS No.: 54745-74-3
    Catalog No.: 102183
    Purity: 95%
    MF: C6H12ClNO
    MW: 149.621
    Storage: 2-8 degree Celsius
    SMILES: Cl[H].C1CC2CNCC1O2
  5. (1R,3r,5S)-tert-butyl 3-amino-8-azabicyclo[3.2.1]octane-8-carboxylate

    CAS No.: 207405-68-3
    Catalog No.: 105104
    Purity: 95%
    MF: C12H22N2O2
    MW: 226.32
    Storage: 2-8 degree Celsius
  6. 8-(tert-butoxycarbonyl)-8-azabicyclo[3.2.1]octane-3-carboxylic acid

    CAS No.: 1159826-74-0
    Catalog No.: 105136
    Purity: 95%
    MF: C13H21NO4
    MW: 255.314
    Storage: 2-8 degree Celsius
  7. tert-butyl 3-cyano-8-azabicyclo[3.2.1]octane-8-carboxylate

    CAS No.: 856900-26-0
    Catalog No.: 105517
    Purity: 95%
    MF: C13H20N2O2
    MW: 236.315
    Storage: 2-8 degree Celsius
  8. tert-butyl 3,6-diazabicyclo[3.2.0]heptane-6-carboxylate

    CAS No.: 122848-57-1
    Catalog No.: 105533
    Purity: 95%
    MF: C10H18N2O2
    MW: 198.266
    Storage: 2-8 degree Celsius
  9. tert-butyl 3-(hydroxymethyl)-8-azabicyclo[3.2.1]octane-8-carboxylate

    CAS No.: 799283-62-8
    Catalog No.: 105540
    Purity: 95%
    MF: C13H23NO3
    MW: 241.331
    Storage: 2-8 degree Celsius
  10. 3-oxa-8-aza-bicyclo[3.2.1]octane

    CAS No.: 280-07-9
    Catalog No.: 106798
    Purity: 95%
    MF: C6H11NO
    MW: 113.16
    Storage: 2-8 degree Celsius
Loading ...Load More ...
Set Descending Direction

   

Items 1 to 10 of 604 total

  1. 1
  2. 2
  3. 3
  4. 4
  5. 5