•  
SSL
0item(s)

You have no items in your shopping cart.

Product was successfully added to your shopping cart.

Autophagy

Set Descending Direction

   

Items 21 to 30 of 32 total

  1. 1
  2. 2
  3. 3
  4. 4
  1. MPP+ iodide

    CAS No.: 36913-39-0
    Catalog No.: 193784
    Purity: 95%
    MF: C12H12IN
    MW: 297.139
    Storage: 2-8 degree Celsius
    SMILES: [I-].C[N+]1=CC=C(C=C1)C1=CC=CC=C1
  2. MK-8719

    CAS No.: 1382799-40-7
    Catalog No.: 193662
    Purity: 95%
    MF: C9H14F2N2O3S
    MW: 268.285
    Storage: 2-8 degree Celsius
    SMILES: FC([C@@H]1[C@H]([C@@H]([C@H]2N\C(\S[C@H]2O1)=N/CC)O)O)F
  3. Isobavachalcone

    CAS No.: 20784-50-3
    Catalog No.: 185612
    Purity: 95%
    MF: C20H20O4
    MW: 324.376
    Storage: 2-8 degree Celsius
    SMILES: OC1=C(C=CC(=C1CC=C(C)C)O)C(\C=C\C1=CC=C(C=C1)O)=O
  4. Spautin-1

    CAS No.: 1262888-28-7
    Catalog No.: 152112
    Purity: 95%
    MF: C15H11F2N3
    MW: 271.27
    Storage: 2-8 degree Celsius
    SMILES: FC1=CC=C(CNC2=NC=NC3=CC=C(F)C=C23)C=C1
  5. SBI-0206965

    CAS No.: 1884220-36-3
    Catalog No.: 152110
    Purity: 95%
    MF: C21H21BrN4O5
    MW: 489.326
    Storage: 2-8 degree Celsius
    SMILES: CNC(=O)C1=C(OC2=C(Br)C=NC(NC3=CC(OC)=C(OC)C(OC)=C3)=N2)C=CC=C1
  6. GNE-9605

    CAS No.: 1536200-31-3
    Catalog No.: 151971
    Purity: 95%
    MF: C17H20ClF4N7O
    MW: 449.84
    Storage: 2-8 degree Celsius
    SMILES: CNC1=C(C=NC(NC2=C(Cl)N(N=C2)[C@@H]2CCN(C[C@H]2F)C2COC2)=N1)C(F)(F)F
  7. Sulfacetamide Sodium

    CAS No.: 127-56-0
    Catalog No.: 141709
    Purity: 95%
    MF: C8H10N2NaO3S+
    MW: 237.236
    Storage: 2-8 degree Celsius
    SMILES: [Na+].CC(=O)NS(=O)(=O)C1=CC=C(N)C=C1
  8. hydroxychloroquine Sulfate

    CAS No.: 747-36-4
    Catalog No.: 141795
    Purity: 95%
    MF: C18H26ClN3O5S-2
    MW: 431.942
    Storage: 2-8 degree Celsius
    SMILES: [O-]S([O-])(=O)=O.CCN(CCO)CCCC(C)NC1=CC=NC2=CC(Cl)=CC=C12
  9. Flubendazole

    CAS No.: 31430-15-6
    Catalog No.: 141463
    Purity: 95%
    MF: C16H12FN3O3
    MW: 313.288
    Storage: 2-8 degree Celsius
    SMILES: COC(=O)NC1=NC2=CC=C(C=C2N1)C(=O)C1=CC=C(F)C=C1
  10. GSK2578215A

    CAS No.: 1285515-21-0
    Catalog No.: 134394
    Purity: 95%
    MF: C24H18FN3O2
    MW: 399.425
    Storage: 2-8 degree Celsius
Loading ...Load More ...
Set Descending Direction

   

Items 21 to 30 of 32 total

  1. 1
  2. 2
  3. 3
  4. 4