•  
SSL
0item(s)

You have no items in your shopping cart.

Product was successfully added to your shopping cart.

Autophagy

Set Descending Direction

   

Items 1 to 10 of 32 total

  1. 1
  2. 2
  3. 3
  4. 4
  1. Gomisin-A

    CAS No.: 58546-54-6
    Catalog No.: 178218
    Purity: 95%
    MF: C23H28O7
    MW: 416.47
    Storage: 2-8 degree Celsius
    SMILES: COC1=C(OC)C(OC)=C2C(CC(C)(O)C(C)CC3=C2C(OC)=C2OCOC2=C3)=C1
  2. EN6

    CAS No.: 1808714-73-9
    Catalog No.: ZB1625
    Purity: 95%
    MF: C19H14F2N4O2
    MW: 368.343
    Storage: 2-8 degree Celsius
    SMILES: C(C=C)(=O)NC=1C=C(C=CC1F)NC(=O)C=1C=NN(C1)C1=C(C=CC=C1)F
  3. S29434

    CAS No.: 874484-20-5
    Catalog No.: ZB1604
    Purity: 95%
    MF: C21H18N4O3
    MW: 374.4
    Storage: 2-8 degree Celsius
    SMILES: COC=1C=CC=2N3CC4=C(C3=C(C2N1)CCNC(=O)C=1OC=CC1)N=CC=C4
  4. LYN-1604 hydrochloride

    CAS No.: 2216753-86-3
    Catalog No.: ZB1551
    Purity: 95%
    MF: C33H44Cl3N3O2
    MW: 621.093
    Storage: 2-8 degree Celsius
    SMILES: Cl.ClC1=C(C=CC(=C1)Cl)C(CN1CCN(CC1)C(CN(CC(C)C)CC(C)C)=O)OCC1=CC2=CC=CC=C2C=C1
  5. DC661

    CAS No.: 1872387-43-3
    Catalog No.: ZB1540
    Purity: 95%
    MF: C31H39Cl2N5
    MW: 552.594
    Storage: 2-8 degree Celsius
    SMILES: ClC1=CC=C2C(=CC=NC2=C1)NCCCCCCN(C)CCCCCCNC1=CC=NC2=CC(=CC=C12)Cl
  6. Autophinib

    CAS No.: 1644443-47-9
    Catalog No.: ZB1499
    Purity: 95%
    MF: C14H11ClN6O3
    MW: 346.734
    Storage: 2-8 degree Celsius
    SMILES: ClC1=CC(=NC(=N1)OC1=CC=C(C=C1)[N+](=O)[O-])NC1=NNC(=C1)C
  7. Aumitin

    CAS No.: 946293-78-3
    Catalog No.: WLZ0312
    Purity: 95%
    MF: C24H20ClN5O
    MW: 429.911
    Storage: 2-8 degree Celsius
    SMILES: ClC1=C(C(=O)NC2=CC=C(C=C2)NC2=NC(=CC(=N2)C)NC2=CC=CC=C2)C=CC=C1
  8. TFEB activator 1

    CAS No.: 39777-61-2
    Catalog No.: WLZ0070
    Purity: 95%
    MF: C19H18O3
    MW: 294.35
    Storage: 2-8 degree Celsius
    SMILES: COC1=C(C=CC=C1)\C=C\C(\C=C\C1=C(C=CC=C1)OC)=O
  9. CA-5f

    CAS No.: 1370032-19-1
    Catalog No.: WLZ0003
    Purity: 95%
    MF: C24H24N2O3
    MW: 388.467
    Storage: 2-8 degree Celsius
    SMILES: COC=1C=C(C=CC1OC)\C=C/1\C(/C(/CN(C1)C)=C/C1=CNC2=CC=CC=C12)=O
  10. MLi-2

    CAS No.: 1627091-47-7
    Catalog No.: 195000
    Purity: 95%
    MF: C21H25N5O2
    MW: 379.464
    Storage: 2-8 degree Celsius
    SMILES: C[C@@H]1CN(C[C@@H](O1)C)C1=NC=NC(=C1)C1=NNC2=CC=C(C=C12)OC1(CC1)C
Loading ...Load More ...
Set Descending Direction

   

Items 1 to 10 of 32 total

  1. 1
  2. 2
  3. 3
  4. 4